2,7-Dinitro-4b,9b-dihydroindeno[2,1-a]indene-5,10-dione structure
|
Common Name | 2,7-Dinitro-4b,9b-dihydroindeno[2,1-a]indene-5,10-dione | ||
|---|---|---|---|---|
| CAS Number | 16293-81-5 | Molecular Weight | 324.24500 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C16H8N2O6 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 2.6-Dinitro-cis-diphensuccindandion |
|---|
| Molecular Formula | C16H8N2O6 |
|---|---|
| Molecular Weight | 324.24500 |
| Exact Mass | 324.03800 |
| PSA | 125.78000 |
| LogP | 3.80940 |
| InChIKey | BXJKCKOGMALGKM-KBPBESRZSA-N |
| SMILES | O=C1c2cc([N+](=O)[O-])ccc2C2C(=O)c3cc([N+](=O)[O-])ccc3C12 |
| HS Code | 2914700090 |
|---|
| Precursor 0 | |
|---|---|
| DownStream 1 | |
| HS Code | 2914700090 |
|---|---|
| Summary | HS: 2914700090 halogenated, sulphonated, nitrated or nitrosated derivatives of ketones and quinones, whether or not with other oxygen function Tax rebate rate:9.0% Supervision conditions:none VAT:17.0% MFN tariff:5.5% General tariff:30.0% |