(S)-(Tetrahydro-2H-pyran-2-YL)methyl trifluoromethanesulfonate
Modify Date: 2025-09-10 10:42:51
(S)-(Tetrahydro-2H-pyran-2-YL)methyl trifluoromethanesulfonate structure
|
Common Name | (S)-(Tetrahydro-2H-pyran-2-YL)methyl trifluoromethanesulfonate | ||
|---|---|---|---|---|
| CAS Number | 1630200-46-2 | Molecular Weight | 248.22 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C7H11F3O4S | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | (S)-(Tetrahydro-2H-pyran-2-YL)methyl trifluoromethanesulfonate |
|---|
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C7H11F3O4S |
|---|---|
| Molecular Weight | 248.22 |
| InChIKey | FMNLRKSSDOVZMF-LURJTMIESA-N |
| SMILES | O=S(=O)(OCC1CCCCO1)C(F)(F)F |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the English name of (S)-(Tetrahydro-2H-pyran-2-YL)methyl trifluoromethanesulfonate? |
| A: The English name of (S)-(Tetrahydro-2H-pyran-2-YL)methyl trifluoromethanesulfonate is (S)-(Tetrahydro-2H-pyran-2-YL)methyl trifluoromethanesulfonate. |
| Q: What is the molecular formula of (S)-(Tetrahydro-2H-pyran-2-YL)methyl trifluoromethanesulfonate? |
| A: Molecular formula of (S)-(Tetrahydro-2H-pyran-2-YL)methyl trifluoromethanesulfonate is C7H11F3O4S. |
| Q: What is the SMILES notation of (S)-(Tetrahydro-2H-pyran-2-YL)methyl trifluoromethanesulfonate? |
| A: SMILES notation of (S)-(Tetrahydro-2H-pyran-2-YL)methyl trifluoromethanesulfonate is O=S(=O)(OCC1CCCCO1)C(F)(F)F. |
| Q: What is the Chinese name of 1630200-46-2? |
| A: Chinese name of 1630200-46-2 is 1630200-46-2. |
| Q: What is the molecular weight of (S)-(Tetrahydro-2H-pyran-2-YL)methyl trifluoromethanesulfonate? |
| A: Molecular weight of (S)-(Tetrahydro-2H-pyran-2-YL)methyl trifluoromethanesulfonate is 248.22. |
| Q: What is the CAS number of (S)-(Tetrahydro-2H-pyran-2-YL)methyl trifluoromethanesulfonate? |
| A: CAS number of (S)-(Tetrahydro-2H-pyran-2-YL)methyl trifluoromethanesulfonate is 1630200-46-2. |
| Q: What is the InChIKey of (S)-(Tetrahydro-2H-pyran-2-YL)methyl trifluoromethanesulfonate? |
| A: InChIKey of (S)-(Tetrahydro-2H-pyran-2-YL)methyl trifluoromethanesulfonate is FMNLRKSSDOVZMF-LURJTMIESA-N. |