1-[[6-(3-Chlorophenyl)-5-methoxy-2-pyrazinyl]methyl]-1H-1,2,4-triazole-3-methanol
Modify Date: 2025-09-23 16:47:58
![1-[[6-(3-Chlorophenyl)-5-methoxy-2-pyrazinyl]methyl]-1H-1,2,4-triazole-3-methanol Structure](https://www.chemsrc.com/extcaspic/091/1631979-74-2.png)
1-[[6-(3-Chlorophenyl)-5-methoxy-2-pyrazinyl]methyl]-1H-1,2,4-triazole-3-methanol structure
|
Common Name | 1-[[6-(3-Chlorophenyl)-5-methoxy-2-pyrazinyl]methyl]-1H-1,2,4-triazole-3-methanol | ||
|---|---|---|---|---|
| CAS Number | 1631979-74-2 | Molecular Weight | 331.76 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C15H14ClN5O2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | 1-[[6-(3-Chlorophenyl)-5-methoxy-2-pyrazinyl]methyl]-1H-1,2,4-triazole-3-methanol |
|---|
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C15H14ClN5O2 |
|---|---|
| Molecular Weight | 331.76 |
| InChIKey | AIRSRIABGPKLOI-UHFFFAOYSA-N |
| SMILES | COc1ncc(Cn2cnc(CO)n2)nc1-c1cccc(Cl)c1 |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the Chinese name of 1631979-74-2? |
| A: Chinese name of 1631979-74-2 is 1631979-74-2. |
| Q: What is the molecular weight of 1-[[6-(3-Chlorophenyl)-5-methoxy-2-pyrazinyl]methyl]-1H-1,2,4-triazole-3-methanol? |
| A: Molecular weight of 1-[[6-(3-Chlorophenyl)-5-methoxy-2-pyrazinyl]methyl]-1H-1,2,4-triazole-3-methanol is 331.76. |
| Q: What is the SMILES notation of 1-[[6-(3-Chlorophenyl)-5-methoxy-2-pyrazinyl]methyl]-1H-1,2,4-triazole-3-methanol? |
| A: SMILES notation of 1-[[6-(3-Chlorophenyl)-5-methoxy-2-pyrazinyl]methyl]-1H-1,2,4-triazole-3-methanol is COc1ncc(Cn2cnc(CO)n2)nc1-c1cccc(Cl)c1. |
| Q: What is the InChIKey of 1-[[6-(3-Chlorophenyl)-5-methoxy-2-pyrazinyl]methyl]-1H-1,2,4-triazole-3-methanol? |
| A: InChIKey of 1-[[6-(3-Chlorophenyl)-5-methoxy-2-pyrazinyl]methyl]-1H-1,2,4-triazole-3-methanol is AIRSRIABGPKLOI-UHFFFAOYSA-N. |
| Q: What is the molecular formula of 1-[[6-(3-Chlorophenyl)-5-methoxy-2-pyrazinyl]methyl]-1H-1,2,4-triazole-3-methanol? |
| A: Molecular formula of 1-[[6-(3-Chlorophenyl)-5-methoxy-2-pyrazinyl]methyl]-1H-1,2,4-triazole-3-methanol is C15H14ClN5O2. |
| Q: What is the English name of 1-[[6-(3-Chlorophenyl)-5-methoxy-2-pyrazinyl]methyl]-1H-1,2,4-triazole-3-methanol? |
| A: The English name of 1-[[6-(3-Chlorophenyl)-5-methoxy-2-pyrazinyl]methyl]-1H-1,2,4-triazole-3-methanol is 1-[[6-(3-Chlorophenyl)-5-methoxy-2-pyrazinyl]methyl]-1H-1,2,4-triazole-3-methanol. |
| Q: What is the CAS number of 1-[[6-(3-Chlorophenyl)-5-methoxy-2-pyrazinyl]methyl]-1H-1,2,4-triazole-3-methanol? |
| A: CAS number of 1-[[6-(3-Chlorophenyl)-5-methoxy-2-pyrazinyl]methyl]-1H-1,2,4-triazole-3-methanol is 1631979-74-2. |