(R)-tert-butyl 3-((3-chloropyridin-2-yl)amino)piperidine-1-carboxylate
Modify Date: 2025-09-10 12:05:00
(R)-tert-butyl 3-((3-chloropyridin-2-yl)amino)piperidine-1-carboxylate structure
|
Common Name | (R)-tert-butyl 3-((3-chloropyridin-2-yl)amino)piperidine-1-carboxylate | ||
|---|---|---|---|---|
| CAS Number | 1632251-01-4 | Molecular Weight | 311.81 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C15H22ClN3O2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | (R)-tert-butyl 3-((3-chloropyridin-2-yl)amino)piperidine-1-carboxylate |
|---|
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C15H22ClN3O2 |
|---|---|
| Molecular Weight | 311.81 |
| InChIKey | WEUZZGDYRJKBLT-LLVKDONJSA-N |
| SMILES | CC(C)(C)OC(=O)N1CCCC(Nc2ncccc2Cl)C1 |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the Chinese name of 1632251-01-4? |
| A: Chinese name of 1632251-01-4 is 1632251-01-4. |
| Q: What is the English name of (R)-tert-butyl 3-((3-chloropyridin-2-yl)amino)piperidine-1-carboxylate? |
| A: The English name of (R)-tert-butyl 3-((3-chloropyridin-2-yl)amino)piperidine-1-carboxylate is (R)-tert-butyl 3-((3-chloropyridin-2-yl)amino)piperidine-1-carboxylate. |
| Q: What is the SMILES notation of (R)-tert-butyl 3-((3-chloropyridin-2-yl)amino)piperidine-1-carboxylate? |
| A: SMILES notation of (R)-tert-butyl 3-((3-chloropyridin-2-yl)amino)piperidine-1-carboxylate is CC(C)(C)OC(=O)N1CCCC(Nc2ncccc2Cl)C1. |
| Q: What is the molecular formula of (R)-tert-butyl 3-((3-chloropyridin-2-yl)amino)piperidine-1-carboxylate? |
| A: Molecular formula of (R)-tert-butyl 3-((3-chloropyridin-2-yl)amino)piperidine-1-carboxylate is C15H22ClN3O2. |
| Q: What is the molecular weight of (R)-tert-butyl 3-((3-chloropyridin-2-yl)amino)piperidine-1-carboxylate? |
| A: Molecular weight of (R)-tert-butyl 3-((3-chloropyridin-2-yl)amino)piperidine-1-carboxylate is 311.81. |
| Q: What is the CAS number of (R)-tert-butyl 3-((3-chloropyridin-2-yl)amino)piperidine-1-carboxylate? |
| A: CAS number of (R)-tert-butyl 3-((3-chloropyridin-2-yl)amino)piperidine-1-carboxylate is 1632251-01-4. |
| Q: What is the InChIKey of (R)-tert-butyl 3-((3-chloropyridin-2-yl)amino)piperidine-1-carboxylate? |
| A: InChIKey of (R)-tert-butyl 3-((3-chloropyridin-2-yl)amino)piperidine-1-carboxylate is WEUZZGDYRJKBLT-LLVKDONJSA-N. |