4-chloro-N-methyl-3-nitro-aniline structure
|
Common Name | 4-chloro-N-methyl-3-nitro-aniline | ||
|---|---|---|---|---|
| CAS Number | 16330-03-3 | Molecular Weight | 186.59600 | |
| Density | 1.406g/cm3 | Boiling Point | 327.6ºC at 760mmHg | |
| Molecular Formula | C7H7ClN2O2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 151.9ºC | |
| Name | 4-chloro-N-methyl-3-nitroaniline |
|---|---|
| Synonym | More Synonyms |
| Density | 1.406g/cm3 |
|---|---|
| Boiling Point | 327.6ºC at 760mmHg |
| Molecular Formula | C7H7ClN2O2 |
| Molecular Weight | 186.59600 |
| Flash Point | 151.9ºC |
| Exact Mass | 186.02000 |
| PSA | 57.85000 |
| LogP | 2.88610 |
| Vapour Pressure | 0.0002mmHg at 25°C |
| Index of Refraction | 1.631 |
| InChIKey | AKWYUIABSIEMJY-UHFFFAOYSA-N |
| SMILES | CNc1ccc(Cl)c([N+](=O)[O-])c1 |
| HS Code | 2921430090 |
|---|
| HS Code | 2921430090 |
|---|---|
| Summary | HS:2921430090 toluidines and their derivatives; salts thereof VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:6.5% General tariff:30.0% |
| 4-CHLORO-N-METHYL-3-NITRO-ANILINE |
| 2-nitro-4-N-methylamino chlorobenzene |
| 4-Chlor-3-nitro-N-methyl-anilin |
| N-Methyl-4-chlor-3-nitroanilin |
| Aniline,4-chloro-N-methyl-3-nitro |