1-benzyl-4-(4-bromophenyl)piperidin-4-ol structure
|
Common Name | 1-benzyl-4-(4-bromophenyl)piperidin-4-ol | ||
|---|---|---|---|---|
| CAS Number | 16332-18-6 | Molecular Weight | 346.26200 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C18H20BrNO | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 1-benzyl-4-(4-bromophenyl)piperidin-4-ol |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C18H20BrNO |
|---|---|
| Molecular Weight | 346.26200 |
| Exact Mass | 345.07300 |
| PSA | 23.47000 |
| LogP | 3.87060 |
| InChIKey | MZPGLOYTGMFUGC-UHFFFAOYSA-N |
| SMILES | OC1(c2ccc(Br)cc2)CCN(Cc2ccccc2)CC1 |
|
~84%
1-benzyl-4-(4-b... CAS#:16332-18-6 |
| Literature: Wenzel, Barbara; Sorger, Dietlind; Heinitz, Katrin; Scheunemann, Matthias; Schliebs, Reinhard; Steinbach, Joerg; Sabri, Osama European Journal of Medicinal Chemistry, 2005 , vol. 40, # 12 p. 1197 - 1205 |
|
~%
1-benzyl-4-(4-b... CAS#:16332-18-6 |
| Literature: Vieira, Eric; Binggeli, Alfred; Breu, Volker; Bur, Daniel; Fischli, Walter; Gueller, Rolf; Hirth, Georges; Maerki, Hans Peter; Mueller, Marcel; Oefner, Christian; Scalone, Michelangelo; Stadler, Heinz; Wilhelm, Maurice; Wostl, Wolfgang Bioorganic and Medicinal Chemistry Letters, 1999 , vol. 9, # 10 p. 1397 - 1402 |
| 1-benzyl-4-(4-bromo-phenyl)-piperidin-4-ol |
| 4-(4-bromophenyl)-1-(phenylmethyl)-4-piperidinol |
| 4-(4-bromophenyl)-1-benzyl-4-hydroxypiperidine |
| 4-Piperidinol,4-(4-bromophenyl)-1-(phenylmethyl) |
| 1-Benzyl-4-p-brom-phenyl-piperidinol-(4) |