ethyl 4-hydroxy-4-phenylpiperidine-1-carboxylate structure
|
Common Name | ethyl 4-hydroxy-4-phenylpiperidine-1-carboxylate | ||
|---|---|---|---|---|
| CAS Number | 16332-22-2 | Molecular Weight | 249.30600 | |
| Density | 1.18g/cm3 | Boiling Point | 389.2ºC at 760mmHg | |
| Molecular Formula | C14H19NO3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 189.2ºC | |
| Name | ethyl 4-hydroxy-4-phenylpiperidine-1-carboxylate |
|---|---|
| Synonym | More Synonyms |
| Density | 1.18g/cm3 |
|---|---|
| Boiling Point | 389.2ºC at 760mmHg |
| Molecular Formula | C14H19NO3 |
| Molecular Weight | 249.30600 |
| Flash Point | 189.2ºC |
| Exact Mass | 249.13600 |
| PSA | 49.77000 |
| LogP | 2.06440 |
| Vapour Pressure | 9.34E-07mmHg at 25°C |
| Index of Refraction | 1.558 |
| InChIKey | YDYRNUOFYGNGMF-UHFFFAOYSA-N |
| SMILES | CCOC(=O)N1CCC(O)(c2ccccc2)CC1 |
|
~%
ethyl 4-hydroxy... CAS#:16332-22-2 |
| Literature: Protiva; Kopicova; Grimova Collection of Czechoslovak Chemical Communications, 1982 , vol. 47, # 2 p. 636 - 643 |
|
~%
ethyl 4-hydroxy... CAS#:16332-22-2 |
| Literature: Praliev, K. D.; Belikova, N. A.; Isin, Zh. I.; Sokolov, D. V. Pharmaceutical Chemistry Journal, 1987 , vol. 21, # 1 p. 60 - 61 Khimiko-Farmatsevticheskii Zhurnal, 1987 , vol. 21, # 1 p. 70 - 71 |
| 1-(Ethoxycarbonyl)-4-phenylpiperidin-4-ol |
| 1-Carbethoxy-4-phenyl-4-piperidinol |
| EINECS 240-406-7 |
| 1-Ethoxycarbonyl-4-phenyl-piperidinol-(4) |
| 4-hydroxy-4-phenyl-piperidine-1-carboxylic acid ethyl ester |
| 1-Piperidinecarboxylicacid,4-hydroxy-4-phenyl-,ethyl ester |