4-O-ACETYL-3 6-DI-O-(TERT-BUTYLDIMETHYL& structure
|
Common Name | 4-O-ACETYL-3 6-DI-O-(TERT-BUTYLDIMETHYL& | ||
|---|---|---|---|---|
| CAS Number | 163381-38-2 | Molecular Weight | 416.70000 | |
| Density | 0.97g/cm3 | Boiling Point | 403ºC at 760mmHg | |
| Molecular Formula | C20H40O5Si2 | Melting Point | 56-59ºC(lit.) | |
| MSDS | N/A | Flash Point | 164.1ºC | |
| Name | [(2R,3S,4R)-4-[tert-butyl(dimethyl)silyl]oxy-2-[[tert-butyl(dimethyl)silyl]oxymethyl]-3,4-dihydro-2H-pyran-3-yl] acetate |
|---|---|
| Synonym | More Synonyms |
| Density | 0.97g/cm3 |
|---|---|
| Boiling Point | 403ºC at 760mmHg |
| Melting Point | 56-59ºC(lit.) |
| Molecular Formula | C20H40O5Si2 |
| Molecular Weight | 416.70000 |
| Flash Point | 164.1ºC |
| Exact Mass | 416.24100 |
| PSA | 53.99000 |
| LogP | 5.24280 |
| Vapour Pressure | 1.05E-06mmHg at 25°C |
| Index of Refraction | 1.46 |
| InChIKey | YJGRGQBNRGUEAY-KZNAEPCWSA-N |
| SMILES | CC(=O)OC1C(O[Si](C)(C)C(C)(C)C)C=COC1CO[Si](C)(C)C(C)(C)C |
| WGK Germany | 3 |
|---|
|
~%
4-O-ACETYL-3 6-... CAS#:163381-38-2 |
| Literature: Kirschning, Andreas Journal of Organic Chemistry, 1995 , vol. 60, # 5 p. 1228 - 1232 |
|
~%
4-O-ACETYL-3 6-... CAS#:163381-38-2 |
| Literature: Kirschning, Andreas Journal of Organic Chemistry, 1995 , vol. 60, # 5 p. 1228 - 1232 |
| 4-O-Acetyl-1,5-anhydro-3,6-bis-O-(tert-butyldimethylsilyl)-2-deoxy-D-lyxo-hex-1-enitol |
| 4-O-Acetyl-3,6-di-O-(tert-butyldimethylsilyl)-D-galactal |
| MFCD01863633 |
| 3-O-acetyl-2,6-anhydro-1,4-bis-O-[tert-butyl(dimethyl)silyl]-5-deoxy-D-arabino-hex-5-enitol |