3-Heptanone,2-(2,4-dinitrophenyl)hydrazone structure
|
Common Name | 3-Heptanone,2-(2,4-dinitrophenyl)hydrazone | ||
|---|---|---|---|---|
| CAS Number | 1634-69-1 | Molecular Weight | 294.30600 | |
| Density | 1.26g/cm3 | Boiling Point | 418.4ºC at 760mmHg | |
| Molecular Formula | C13H18N4O4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 206.8ºC | |
| Name | N-[(Z)-heptan-3-ylideneamino]-2,4-dinitroaniline |
|---|---|
| Synonym | More Synonyms |
| Density | 1.26g/cm3 |
|---|---|
| Boiling Point | 418.4ºC at 760mmHg |
| Molecular Formula | C13H18N4O4 |
| Molecular Weight | 294.30600 |
| Flash Point | 206.8ºC |
| Exact Mass | 294.13300 |
| PSA | 116.03000 |
| LogP | 4.99050 |
| Vapour Pressure | 3.3E-07mmHg at 25°C |
| Index of Refraction | 1.578 |
| InChIKey | ZYYAHBWEWWDHQZ-UVTDQMKNSA-N |
| SMILES | CCCCC(CC)=NNc1ccc([N+](=O)[O-])cc1[N+](=O)[O-] |
|
~%
3-Heptanone,2-(... CAS#:1634-69-1 |
| Literature: Ager, David J. Journal of the Chemical Society, Perkin Transactions 1: Organic and Bio-Organic Chemistry (1972-1999), 1986 , p. 183 - 194 |
|
~%
3-Heptanone,2-(... CAS#:1634-69-1 |
| Literature: Ager, David J. Journal of the Chemical Society, Perkin Transactions 1: Organic and Bio-Organic Chemistry (1972-1999), 1986 , p. 183 - 194 |
| Precursor 3 | |
|---|---|
| DownStream 0 | |
| Heptan-3-on-(2,4-dinitro-phenylhydrazon) |
| Ethyl-butyl-keton-2,4-dinitro-phenylhydrazon |
| 3-Oxoheptan-2,4-dinitrophenylhydrazon |
| heptan-3-one-(2,4-dinitro-phenylhydrazone) |