Fmoc-Met(O2)-OH structure
|
Common Name | Fmoc-Met(O2)-OH | ||
|---|---|---|---|---|
| CAS Number | 163437-14-7 | Molecular Weight | 403.449 | |
| Density | 1.4±0.1 g/cm3 | Boiling Point | 709.5±60.0 °C at 760 mmHg | |
| Molecular Formula | C20H21NO6S | Melting Point | N/A | |
| MSDS | USA | Flash Point | 382.9±32.9 °C | |
| Name | (2S)-2-(9H-fluoren-9-ylmethoxycarbonylamino)-4-methylsulfonylbutanoic acid |
|---|---|
| Synonym | More Synonyms |
| Density | 1.4±0.1 g/cm3 |
|---|---|
| Boiling Point | 709.5±60.0 °C at 760 mmHg |
| Molecular Formula | C20H21NO6S |
| Molecular Weight | 403.449 |
| Flash Point | 382.9±32.9 °C |
| Exact Mass | 403.108948 |
| PSA | 118.15000 |
| LogP | 2.95 |
| Vapour Pressure | 0.0±2.4 mmHg at 25°C |
| Index of Refraction | 1.606 |
| InChIKey | KJLKPACOHZKRFM-SFHVURJKSA-N |
| SMILES | CS(=O)(=O)CCC(NC(=O)OCC1c2ccccc2-c2ccccc21)C(=O)O |
| Storage condition | Store at RT. |
| HS Code | 2924299090 |
|---|
| HS Code | 2924299090 |
|---|---|
| Summary | 2924299090. other cyclic amides (including cyclic carbamates) and their derivatives; salts thereof. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |
| FMOC-MET(O2)-OH |
| Butanoic acid, 2-[[(9H-fluoren-9-ylmethoxy)carbonyl]amino]-4-(methylsulfonyl)-, (2S)- |
| AmbotzFAA1406 |
| MFCD00153361 |
| (2S)-2-{[(9H-Fluoren-9-ylmethoxy)carbonyl]amino}-4-(methylsulfonyl)butanoic acid |
| (S)-2-((((9H-Fluoren-9-yl)methoxy)carbonyl)amino)-4-(methylsulfonyl)butanoic acid |
| QC-265 |
| Fmoc-L-methionine sulfone |