1-(4-METHYLPHENYL)PYRIMIDINE-2,4,6(1H,3H,5H)-TRIONE structure
|
Common Name | 1-(4-METHYLPHENYL)PYRIMIDINE-2,4,6(1H,3H,5H)-TRIONE | ||
|---|---|---|---|---|
| CAS Number | 16348-04-2 | Molecular Weight | 218.20900 | |
| Density | 1.334g/cm3 | Boiling Point | N/A | |
| Molecular Formula | C11H10N2O3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 1-(4-methylphenyl)-1,3-diazinane-2,4,6-trione |
|---|---|
| Synonym | More Synonyms |
| Density | 1.334g/cm3 |
|---|---|
| Molecular Formula | C11H10N2O3 |
| Molecular Weight | 218.20900 |
| Exact Mass | 218.06900 |
| PSA | 69.97000 |
| LogP | 1.30880 |
| Index of Refraction | 1.587 |
| InChIKey | WLGYFVCNEFNYKO-UHFFFAOYSA-N |
| SMILES | Cc1ccc(N2C(=O)CC(=O)NC2=O)cc1 |
| HS Code | 2933540000 |
|---|
| Precursor 1 | |
|---|---|
| DownStream 0 | |
| HS Code | 2933540000 |
|---|---|
| Summary | 2933540000 other derivatives of malonylurea (barbituric acid); salts thereof。Supervision conditions:None。VAT:17.0%。Tax rebate rate:9.0%。MFN tariff:6.5%。General tariff:20.0% |
| 1-(4-methylphenyl)pyrimidine-2,4,6(1H,3H,5H)-trione |
| F1912-0022 |
| 1-(4-methylphenyl)-1,3,5-trihydropyrimidine-2,4,6-trione |
| 1-(p-Tolyl)-barbitursaeure |
| 1-p-tolylpyrimidine-2,4,6-trione |
| 1-p-tolyl-barbituric acid |