1-(2-METHOXYPHENYL)PYRIMIDINE-2,4,6(1H,3H,5H)-TRIONE structure
|
Common Name | 1-(2-METHOXYPHENYL)PYRIMIDINE-2,4,6(1H,3H,5H)-TRIONE | ||
|---|---|---|---|---|
| CAS Number | 16348-07-5 | Molecular Weight | 234.20800 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C11H10N2O4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 1-(2-methoxyphenyl)-1,3-diazinane-2,4,6-trione |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C11H10N2O4 |
|---|---|
| Molecular Weight | 234.20800 |
| Exact Mass | 234.06400 |
| PSA | 79.20000 |
| LogP | 1.00900 |
| InChIKey | PEYOYDLJJVRUQB-UHFFFAOYSA-N |
| SMILES | COc1ccccc1N1C(=O)CC(=O)NC1=O |
| HS Code | 2933540000 |
|---|
|
~42%
1-(2-METHOXYPHE... CAS#:16348-07-5 |
| Literature: Ingle; Gaidhane; Dutta; Naha; Sengupta Journal of Carbohydrate Chemistry, 2006 , vol. 25, # 8-9 p. 661 - 671 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| HS Code | 2933540000 |
|---|---|
| Summary | 2933540000 other derivatives of malonylurea (barbituric acid); salts thereof。Supervision conditions:None。VAT:17.0%。Tax rebate rate:9.0%。MFN tariff:6.5%。General tariff:20.0% |
| HMS2953E17 |
| 1-(2-methoxy-phenyl)-pyrimidine-2,4,6-trione |
| 1-(2-Methoxy-phenyl)-barbitursaeure |
| F1912-0023 |