1,3,5,7,2,4,6,8-Tetrazatetraphosphocine,2,2,4,4,6,6,8,8-octakis(ethylamino)-2,2,4,4,6,6,8,8-octahydro- (7CI,8CI,9CI) structure
|
Common Name | 1,3,5,7,2,4,6,8-Tetrazatetraphosphocine,2,2,4,4,6,6,8,8-octakis(ethylamino)-2,2,4,4,6,6,8,8-octahydro- (7CI,8CI,9CI) | ||
|---|---|---|---|---|
| CAS Number | 1635-66-1 | Molecular Weight | 532.52800 | |
| Density | 1.35g/cm3 | Boiling Point | 584.8ºC at 760mmHg | |
| Molecular Formula | C16H48N12P4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 307.5ºC | |
| Name | octakis(ethylamino)cyclotetraphosphazatetraene |
|---|---|
| Synonym | More Synonyms |
| Density | 1.35g/cm3 |
|---|---|
| Boiling Point | 584.8ºC at 760mmHg |
| Molecular Formula | C16H48N12P4 |
| Molecular Weight | 532.52800 |
| Flash Point | 307.5ºC |
| Exact Mass | 532.30800 |
| PSA | 184.92000 |
| LogP | 5.53040 |
| Vapour Pressure | 1.16E-13mmHg at 25°C |
| Index of Refraction | 1.61 |
| InChIKey | WEHSXWNJBWLBPD-UHFFFAOYSA-N |
| SMILES | CCNP1(NCC)=NP(NCC)(NCC)=NP(NCC)(NCC)=NP(NCC)(NCC)=N1 |
|
~%
1,3,5,7,2,4,6,8... CAS#:1635-66-1 |
| Literature: Krishnamurthy,S.S. et al. Journal of the Chemical Society, Dalton Transactions: Inorganic Chemistry (1972-1999), 1976 , p. 1405 - 1410 |
|
~18%
1,3,5,7,2,4,6,8... CAS#:1635-66-1 |
| Literature: Contractor, Sorab R.; Kilic, Zeynel; Shaw, Robert A. Journal of the Chemical Society, Dalton Transactions: Inorganic Chemistry (1972-1999), 1987 , p. 2023 - 2030 |
| Precursor 1 | |
|---|---|
| DownStream 0 | |
| N2,N2,N4,N4,N6,N6,N8,N8-octaethyl-1,3,5,7-tetraza-2 |
| l^{5},4 |
| l^{5},6 |
| l^ {5},8 |
| l^{5}-tetraphosphacycloocta-1,3,5,7-tetraene-2,2,4,4,6,6,8,8-oct amine |