1,3-bis(4-chlorophenyl)-5-ethyl-1,3-diazinane-2,4,6-trione
1,3-bis(4-chlorophenyl)-5-ethyl-1,3-diazinane-2,4,6-trione structure
|
Common Name | 1,3-bis(4-chlorophenyl)-5-ethyl-1,3-diazinane-2,4,6-trione | ||
|---|---|---|---|---|
| CAS Number | 16357-95-2 | Molecular Weight | 377.22100 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C18H14Cl2N2O3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | 1,3-bis(4-chlorophenyl)-5-ethyl-1,3-diazinane-2,4,6-trione |
|---|---|
| Synonym | More Synonyms |
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C18H14Cl2N2O3 |
|---|---|
| Molecular Weight | 377.22100 |
| Exact Mass | 376.03800 |
| PSA | 57.69000 |
| LogP | 4.64940 |
| InChIKey | RYGKGTFFEUXNHP-UHFFFAOYSA-N |
| SMILES | CCC1C(=O)N(c2ccc(Cl)cc2)C(=O)N(c2ccc(Cl)cc2)C1=O |
This table presents publicly reported synthetic routes, reaction conditions, reactants and product information of the compound.
|
~81%
1,3-bis(4-chlor... CAS#:16357-95-2 |
| Literature: Takahata, Hiroki; Nakajima, Tomoko; Yamazaki, Takao Synthetic Communications, 1984 , vol. 14, # 7 p. 675 - 680 |
|
~%
1,3-bis(4-chlor... CAS#:16357-95-2 |
| Literature: Takahata, Hiroki; Nakajima, Tomoko; Yamazaki, Takao Synthetic Communications, 1984 , vol. 14, # 7 p. 675 - 680 |
This table collects all English aliases, systematic names and CAS‑related synonyms of the compound.
| 2,4,6(1H,3H,5H)-Pyrimidinetrione,1,3-bis(4-chlorophenyl)-5-ethyl |
| 1.3-Bis-<4-chlor-phenyl>-5-aethyl-barbitursaeure |
| 1,3-bis-(4-chloro-phenyl)-5-ethyl-pyrimidine-2,4,6-trione |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the molecular weight of 1,3-bis(4-chlorophenyl)-5-ethyl-1,3-diazinane-2,4,6-trione? |
| A: Molecular weight of 1,3-bis(4-chlorophenyl)-5-ethyl-1,3-diazinane-2,4,6-trione is 377.22100. |
| Q: What English synonyms does 1,3-bis(4-chlorophenyl)-5-ethyl-1,3-diazinane-2,4,6-trione have? |
| A: English synonyms of 1,3-bis(4-chlorophenyl)-5-ethyl-1,3-diazinane-2,4,6-trione: 2,4,6(1H,3H,5H)-Pyrimidinetrione,1,3-bis(4-chlorophenyl)-5-ethyl, 1.3-Bis--5-aethyl-barbitursaeure, 1,3-bis-(4-chloro-phenyl)-5-ethyl-pyrimidine-2,4,6-trione. |
| Q: What is the InChIKey of 1,3-bis(4-chlorophenyl)-5-ethyl-1,3-diazinane-2,4,6-trione? |
| A: InChIKey of 1,3-bis(4-chlorophenyl)-5-ethyl-1,3-diazinane-2,4,6-trione is RYGKGTFFEUXNHP-UHFFFAOYSA-N. |
| Q: What is the CAS number of 1,3-bis(4-chlorophenyl)-5-ethyl-1,3-diazinane-2,4,6-trione? |
| A: CAS number of 1,3-bis(4-chlorophenyl)-5-ethyl-1,3-diazinane-2,4,6-trione is 16357-95-2. |
| Q: What is the English name of 1,3-bis(4-chlorophenyl)-5-ethyl-1,3-diazinane-2,4,6-trione? |
| A: The English name of 1,3-bis(4-chlorophenyl)-5-ethyl-1,3-diazinane-2,4,6-trione is 1,3-bis(4-chlorophenyl)-5-ethyl-1,3-diazinane-2,4,6-trione. |
| Q: What is the polar surface area (PSA) of 1,3-bis(4-chlorophenyl)-5-ethyl-1,3-diazinane-2,4,6-trione? |
| A: Polar surface area (PSA) of 1,3-bis(4-chlorophenyl)-5-ethyl-1,3-diazinane-2,4,6-trione is 57.69000. |
| Q: What is the Chinese name of 16357-95-2? |
| A: Chinese name of 16357-95-2 is 16357-95-2. |
| Q: What is the SMILES notation of 1,3-bis(4-chlorophenyl)-5-ethyl-1,3-diazinane-2,4,6-trione? |
| A: SMILES notation of 1,3-bis(4-chlorophenyl)-5-ethyl-1,3-diazinane-2,4,6-trione is CCC1C(=O)N(c2ccc(Cl)cc2)C(=O)N(c2ccc(Cl)cc2)C1=O. |
| Q: What is the LogP of 1,3-bis(4-chlorophenyl)-5-ethyl-1,3-diazinane-2,4,6-trione? |
| A: LogP of 1,3-bis(4-chlorophenyl)-5-ethyl-1,3-diazinane-2,4,6-trione is 4.64940. |
| Q: What is the molecular formula of 1,3-bis(4-chlorophenyl)-5-ethyl-1,3-diazinane-2,4,6-trione? |
| A: Molecular formula of 1,3-bis(4-chlorophenyl)-5-ethyl-1,3-diazinane-2,4,6-trione is C18H14Cl2N2O3. |