Poly(tetramethylene-3-methyltetramethylene ether)glycol bis(4-aminobenzoate) structure
|
Common Name | Poly(tetramethylene-3-methyltetramethylene ether)glycol bis(4-aminobenzoate) | ||
|---|---|---|---|---|
| CAS Number | 163578-99-2 | Molecular Weight | 414.49500 | |
| Density | 1.174 g/cm3 | Boiling Point | 594.6ºC at 760 mmHg | |
| Molecular Formula | C23H30N2O5 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 4-[4-(4-aminobenzoyl)oxy-3-methylbutoxy]butyl 4-aminobenzoate |
|---|---|
| Synonym | More Synonyms |
| Density | 1.174 g/cm3 |
|---|---|
| Boiling Point | 594.6ºC at 760 mmHg |
| Molecular Formula | C23H30N2O5 |
| Molecular Weight | 414.49500 |
| Exact Mass | 414.21500 |
| PSA | 113.87000 |
| LogP | 4.85020 |
| Vapour Pressure | 4.15E-14mmHg at 25°C |
| Index of Refraction | 1.574 |
| InChIKey | JIWNZVALGCBGQT-UHFFFAOYSA-N |
| SMILES | CC(CCOCCCCOC(=O)c1ccc(N)cc1)COC(=O)c1ccc(N)cc1 |
| HS Code | 2922509090 |
|---|
| HS Code | 2922509090 |
|---|---|
| Summary | 2922509090. other amino-alcohol-phenols, amino-acid-phenols and other amino-compounds with oxygen function. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |
| Poly(tetramethylene/3-methyl tetramethylene ether)glycol bis(4-aminobenzoate) [SL-100A] |
| Poly(tetramethylene-3-methyltetramethylene ether)glycol bis(4-aminobenzoate) |