Ethyl (2E)-2-[(4-bromophenyl)hydrazono]propanoate structure
|
Common Name | Ethyl (2E)-2-[(4-bromophenyl)hydrazono]propanoate | ||
|---|---|---|---|---|
| CAS Number | 16382-11-9 | Molecular Weight | 285.137 | |
| Density | 1.4±0.1 g/cm3 | Boiling Point | 339.4±44.0 °C at 760 mmHg | |
| Molecular Formula | C11H13BrN2O2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 159.1±28.4 °C | |
| Name | ethyl (2E)-2-[(4-bromophenyl)hydrazinylidene]propanoate |
|---|---|
| Synonym | More Synonyms |
| Density | 1.4±0.1 g/cm3 |
|---|---|
| Boiling Point | 339.4±44.0 °C at 760 mmHg |
| Molecular Formula | C11H13BrN2O2 |
| Molecular Weight | 285.137 |
| Flash Point | 159.1±28.4 °C |
| Exact Mass | 284.016022 |
| PSA | 50.69000 |
| LogP | 3.38 |
| Vapour Pressure | 0.0±0.7 mmHg at 25°C |
| Index of Refraction | 1.559 |
| InChIKey | GLSYARFJOAOUKJ-MDWZMJQESA-N |
| SMILES | CCOC(=O)C(C)=NNc1ccc(Br)cc1 |
| HS Code | 2928000090 |
|---|
| HS Code | 2928000090 |
|---|---|
| Summary | 2928000090 other organic derivatives of hydrazine or of hydroxylamine VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:6.5% General tariff:20.0% |
| Ethyl (2E)-2-[(4-bromophenyl)hydrazono]propanoate |
| ethyl pyruvate 4-bromophenylhydrazone |
| Propanoic acid, 2-[2-(4-bromophenyl)hydrazinylidene]-, ethyl ester, (2E)- |