2-(4-Methoxyphenyl)-3,3-diphenylacrylaldehyde structure
|
Common Name | 2-(4-Methoxyphenyl)-3,3-diphenylacrylaldehyde | ||
|---|---|---|---|---|
| CAS Number | 16384-67-1 | Molecular Weight | 314.37700 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C22H18O2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 2-(4-methoxyphenyl)-3,3-diphenylprop-2-enal |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C22H18O2 |
|---|---|
| Molecular Weight | 314.37700 |
| Exact Mass | 314.13100 |
| PSA | 26.30000 |
| LogP | 4.85320 |
| InChIKey | UHICFZCYLORALY-UHFFFAOYSA-N |
| SMILES | COc1ccc(C(C=O)=C(c2ccccc2)c2ccccc2)cc1 |
| HS Code | 2912499000 |
|---|
| HS Code | 2912499000 |
|---|---|
| Summary | 2912499000. other aldehyde-ethers, aldehyde-phenols and aldehydes with other oxygen function. VAT:17.0%. Tax rebate rate:9.0%. . MFN tariff:5.5%. General tariff:30.0% |
| 2-(4-Methoxyphenyl)-3,3-diphenylacrylaldehyde |
| Acrolein,2-(p-methoxyphenyl)-3,3-diphenyl |