7-chloro-5-phenyl-3H-1,4-benzodiazepine structure
|
Common Name | 7-chloro-5-phenyl-3H-1,4-benzodiazepine | ||
|---|---|---|---|---|
| CAS Number | 16398-00-8 | Molecular Weight | 254.71400 | |
| Density | 1.22g/cm3 | Boiling Point | 411ºC at 760 mmHg | |
| Molecular Formula | C15H11ClN2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 202.4ºC | |
| Name | 7-chloro-5-phenyl-3H-1,4-benzodiazepine |
|---|---|
| Synonym | More Synonyms |
| Density | 1.22g/cm3 |
|---|---|
| Boiling Point | 411ºC at 760 mmHg |
| Molecular Formula | C15H11ClN2 |
| Molecular Weight | 254.71400 |
| Flash Point | 202.4ºC |
| Exact Mass | 254.06100 |
| PSA | 24.72000 |
| LogP | 2.76450 |
| Vapour Pressure | 1.37E-06mmHg at 25°C |
| Index of Refraction | 1.64 |
| InChIKey | GIVYEEPCHMGCEK-UHFFFAOYSA-N |
| SMILES | Clc1ccc2c(c1)C(c1ccccc1)=NCC=N2 |
| HS Code | 2933990090 |
|---|
| HS Code | 2933990090 |
|---|---|
| Summary | 2933990090. heterocyclic compounds with nitrogen hetero-atom(s) only. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| Ro 7-0220 |
| 7-chloro-5-phenyl-3H-benzo[e][1,4]diazepine |
| 3H-1,4-BENZODIAZEPINE,7-CHLORO-5-PHENYL |
| 7-Chlor-5-phenyl-3H-1,4-benzodiazepin |