Carbamic acid,N-phenyl-, 2-chlorophenyl ester structure
|
Common Name | Carbamic acid,N-phenyl-, 2-chlorophenyl ester | ||
|---|---|---|---|---|
| CAS Number | 16400-07-0 | Molecular Weight | 247.67700 | |
| Density | 1.329g/cm3 | Boiling Point | 347.9ºC at 760 mmHg | |
| Molecular Formula | C13H10ClNO2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 164.2ºC | |
| Name | (2-chlorophenyl) N-phenylcarbamate |
|---|---|
| Synonym | More Synonyms |
| Density | 1.329g/cm3 |
|---|---|
| Boiling Point | 347.9ºC at 760 mmHg |
| Molecular Formula | C13H10ClNO2 |
| Molecular Weight | 247.67700 |
| Flash Point | 164.2ºC |
| Exact Mass | 247.04000 |
| PSA | 38.33000 |
| LogP | 4.02390 |
| Vapour Pressure | 5.22E-05mmHg at 25°C |
| Index of Refraction | 1.638 |
| InChIKey | LWZQUJXOWUUZQW-UHFFFAOYSA-N |
| SMILES | O=C(Nc1ccccc1)Oc1ccccc1Cl |
| HS Code | 2924299090 |
|---|
|
~%
Carbamic acid,N... CAS#:16400-07-0 |
| Literature: Michael; Cobb Justus Liebigs Annalen der Chemie, 1908 , vol. 363, p. 78 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| HS Code | 2924299090 |
|---|---|
| Summary | 2924299090. other cyclic amides (including cyclic carbamates) and their derivatives; salts thereof. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |
| 2-chlorophenyl phenylcarbamate |
| N-Phenyl-o-chlorphenylcarbamat |
| N-Phenyl-carbamidsaeure-<2-chlor-phenylester> |
| o-Chlorphenyl-N-phenylcarbamat |
| N-Phenyl-carbaminsaeure-<2-chlor-phenylester> |