4H-1-Benzopyran-3-carbonitrile, 2-amino-5,6,7,8-tetrahydro-4-phenyl- structure
|
Common Name | 4H-1-Benzopyran-3-carbonitrile, 2-amino-5,6,7,8-tetrahydro-4-phenyl- | ||
|---|---|---|---|---|
| CAS Number | 164026-52-2 | Molecular Weight | 252.31100 | |
| Density | 1.21g/cm3 | Boiling Point | 507.7ºC at 760 mmHg | |
| Molecular Formula | C16H16N2O | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 260.8ºC | |
| Name | 4H-1-Benzopyran-3-carbonitrile, 2-amino-5,6,7,8-tetrahydro-4-phenyl |
|---|---|
| Synonym | More Synonyms |
| Density | 1.21g/cm3 |
|---|---|
| Boiling Point | 507.7ºC at 760 mmHg |
| Molecular Formula | C16H16N2O |
| Molecular Weight | 252.31100 |
| Flash Point | 260.8ºC |
| Exact Mass | 252.12600 |
| PSA | 59.04000 |
| LogP | 4.02268 |
| Vapour Pressure | 1.99E-10mmHg at 25°C |
| Index of Refraction | 1.625 |
| InChIKey | ZXQHIGYTTMBISV-UHFFFAOYSA-N |
| SMILES | N#CC1=C(N)OC2=C(CCCC2)C1c1ccccc1 |
| HS Code | 2932999099 |
|---|
| HS Code | 2932999099 |
|---|---|
| Summary | 2932999099. other heterocyclic compounds with oxygen hetero-atom(s) only. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| 2-Amino-3-cyano-4-methylpyrrol |
| 2-amino-3-cyano-4-phenyl-5,6,7,8-tetrahydro-4H-chromene |
| 2-amino-3-cyano-4-methyl-pyrrole |
| 2-amino-3-cyano-4-phenyl-5,6,7,8-tetrahydro-4H-benzopyrane |
| 2-Amino-3-cyan-4-methyl-pyrrol |
| 5-Amino-3-methyl-4-cyanpyrrol |
| 2-amino-4-methyl-3-pyrrole carbonitrile |
| 2-amino-4-methyl-pyrrole-3-carbonitrile |