ethyl5-((tert-butoxycarbonylamino)methyl)-1,2,4-oxadiazole-3-carboxylate structure
|
Common Name | ethyl5-((tert-butoxycarbonylamino)methyl)-1,2,4-oxadiazole-3-carboxylate | ||
|---|---|---|---|---|
| CAS Number | 164029-34-9 | Molecular Weight | 271.270 | |
| Density | 1.2±0.1 g/cm3 | Boiling Point | N/A | |
| Molecular Formula | C11H17N3O5 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | ethyl 5-[[(2-methylpropan-2-yl)oxycarbonylamino]methyl]-1,2,4-oxadiazole-3-carboxylate |
|---|---|
| Synonym | More Synonyms |
| Density | 1.2±0.1 g/cm3 |
|---|---|
| Molecular Formula | C11H17N3O5 |
| Molecular Weight | 271.270 |
| Exact Mass | 271.116821 |
| PSA | 107.04000 |
| LogP | 1.41 |
| Index of Refraction | 1.488 |
| InChIKey | MOPZSTLPRGHTKB-UHFFFAOYSA-N |
| SMILES | CCOC(=O)c1noc(CNC(=O)OC(C)(C)C)n1 |
| HS Code | 2934999090 |
|---|
|
~%
ethyl5-((tert-b... CAS#:164029-34-9 |
| Literature: Journal of Organic Chemistry, , vol. 60, # 10 p. 3112 - 3120 |
| HS Code | 2934999090 |
|---|---|
| Summary | 2934999090. other heterocyclic compounds. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| 1,2,4-Oxadiazole-3-carboxylic acid, 5-[[[(1,1-dimethylethoxy)carbonyl]amino]methyl]-, ethyl ester |
| Ethyl 5-{[(tert-butoxycarbonyl)amino]methyl}-1,2,4-oxadiazole-3-carboxylate |
| Ethyl 5-<<(tert-butyloxycarbonyl)amino>methyl>-1,2,4-oxadiazole-3-carboxylate |
| Ethyl 5-[({[(2-methyl-2-propanyl)oxy]carbonyl}amino)methyl]-1,2,4-oxadiazole-3-carboxylate |
| 5-[[[1,1-dimethylethoxycarbonyl]amino]methyl]-1,2,4-oxadiazole-3-carboxylic acid ethyl ester |
| 5-[[(tert-butoxycarbonyl)amino]methyl]-1,2,4-oxadiazole-3-carboxylic acid ethyl ester |
| ethyl N-Boc-5-aminomethyl-1,2,4-oxadiazole-3-carboxylate |
| ethyl 5-((tert-butoxycarbonylamino)methyl)-1,2,4-oxadiazole-3-carboxylate |
| ethyl5-((tert-butoxycarbonylamino)methyl)-1,2,4-oxadiazole-3-carboxylate |