2,4-Dimethylphenoxytrimethylsilane structure
|
Common Name | 2,4-Dimethylphenoxytrimethylsilane | ||
|---|---|---|---|---|
| CAS Number | 16414-81-6 | Molecular Weight | 194.34600 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C11H18OSi | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | (2,4-dimethylphenoxy)-trimethylsilane |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C11H18OSi |
|---|---|
| Molecular Weight | 194.34600 |
| Exact Mass | 194.11300 |
| PSA | 9.23000 |
| LogP | 3.51710 |
| InChIKey | RQIFPNBYDRMGRO-UHFFFAOYSA-N |
| SMILES | Cc1ccc(O[Si](C)(C)C)c(C)c1 |
| HS Code | 2931900090 |
|---|
| Precursor 0 | |
|---|---|
| DownStream 1 | |
| HS Code | 2931900090 |
|---|---|
| Summary | 2931900090. other organo-inorganic compounds. VAT:17.0%. Tax rebate rate:13.0%. Supervision conditions:AB(certificate of inspection for goods inward,certificate of inspection for goods outward). MFN tariff:6.5%. General tariff:30.0% |
| 2,4-Dimethylphenoxytrimethylsilane |
| Silane,trimethyl(2,4-xylyloxy) |
| Silane,(2,4-dimethylphenoxy)trimethyl |