Diallyl (4-(hydroxymethyl)phenyl) phosphate
Modify Date: 2025-09-10 05:51:14
Diallyl (4-(hydroxymethyl)phenyl) phosphate structure
|
Common Name | Diallyl (4-(hydroxymethyl)phenyl) phosphate | ||
|---|---|---|---|---|
| CAS Number | 1641997-76-3 | Molecular Weight | 284.24 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C13H17O5P | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | Diallyl (4-(hydroxymethyl)phenyl) phosphate |
|---|
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C13H17O5P |
|---|---|
| Molecular Weight | 284.24 |
| InChIKey | VVMNDVNZSKYBSG-UHFFFAOYSA-N |
| SMILES | C=CCOP(=O)(OCC=C)Oc1ccc(CO)cc1 |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the molecular formula of Diallyl (4-(hydroxymethyl)phenyl) phosphate? |
| A: Molecular formula of Diallyl (4-(hydroxymethyl)phenyl) phosphate is C13H17O5P. |
| Q: What is the CAS number of Diallyl (4-(hydroxymethyl)phenyl) phosphate? |
| A: CAS number of Diallyl (4-(hydroxymethyl)phenyl) phosphate is 1641997-76-3. |
| Q: What is the molecular weight of Diallyl (4-(hydroxymethyl)phenyl) phosphate? |
| A: Molecular weight of Diallyl (4-(hydroxymethyl)phenyl) phosphate is 284.24. |
| Q: What is the InChIKey of Diallyl (4-(hydroxymethyl)phenyl) phosphate? |
| A: InChIKey of Diallyl (4-(hydroxymethyl)phenyl) phosphate is VVMNDVNZSKYBSG-UHFFFAOYSA-N. |
| Q: What is the Chinese name of 1641997-76-3? |
| A: Chinese name of 1641997-76-3 is 1641997-76-3. |
| Q: What is the English name of Diallyl (4-(hydroxymethyl)phenyl) phosphate? |
| A: The English name of Diallyl (4-(hydroxymethyl)phenyl) phosphate is Diallyl (4-(hydroxymethyl)phenyl) phosphate. |
| Q: What is the SMILES notation of Diallyl (4-(hydroxymethyl)phenyl) phosphate? |
| A: SMILES notation of Diallyl (4-(hydroxymethyl)phenyl) phosphate is C=CCOP(=O)(OCC=C)Oc1ccc(CO)cc1. |