2-bromo-3,5-dinitropyridine structure
|
Common Name | 2-bromo-3,5-dinitropyridine | ||
|---|---|---|---|---|
| CAS Number | 16420-30-7 | Molecular Weight | 247.99100 | |
| Density | 2.023 g/cm3 | Boiling Point | 300ºC at 760 mmHg | |
| Molecular Formula | C5H2BrN3O4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 135.2ºC | |
| Name | 2-bromo-3,5-dinitropyridine |
|---|---|
| Synonym | More Synonyms |
| Density | 2.023 g/cm3 |
|---|---|
| Boiling Point | 300ºC at 760 mmHg |
| Molecular Formula | C5H2BrN3O4 |
| Molecular Weight | 247.99100 |
| Flash Point | 135.2ºC |
| Exact Mass | 246.92300 |
| PSA | 104.53000 |
| LogP | 2.70690 |
| Vapour Pressure | 0.00206mmHg at 25°C |
| Index of Refraction | 1.658 |
| InChIKey | DTSYPWHCOVBOLN-UHFFFAOYSA-N |
| SMILES | O=[N+]([O-])c1cnc(Br)c([N+](=O)[O-])c1 |
| HS Code | 2933399090 |
|---|
|
~%
Detail
|
| Literature: Molander, Gary A.; Cavalcanti, Livia N. Journal of Organic Chemistry, 2012 , vol. 77, # 9 p. 4402 - 4413 |
|
~%
2-bromo-3,5-din... CAS#:16420-30-7 |
| Literature: van Ammers; den Hertog Recueil des Travaux Chimiques des Pays-Bas, 1956 , vol. 75, p. 1259,1261, 1262 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| HS Code | 2933399090 |
|---|---|
| Summary | 2933399090. other compounds containing an unfused pyridine ring (whether or not hydrogenated) in the structure. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| 2-bromanyl-3,5-dinitro-pyridine |
| Pyridine,2-bromo-3,5-dinitro |
| 2-bromo-3,5-dinitro-pyridine |
| 2-Brom-3,5-dinitro-pyridin |