6-Chloro-1,3,3-trimethyl-1H,2H,3H-pyrrolo[3,2-c]pyridin-2-one
Modify Date: 2026-08-28 19:34:14
![6-Chloro-1,3,3-trimethyl-1H,2H,3H-pyrrolo[3,2-c]pyridin-2-one Structure](https://www.chemsrc.com/extcaspic/252/1642801-68-0.png)
6-Chloro-1,3,3-trimethyl-1H,2H,3H-pyrrolo[3,2-c]pyridin-2-one structure
|
Common Name | 6-Chloro-1,3,3-trimethyl-1H,2H,3H-pyrrolo[3,2-c]pyridin-2-one | ||
|---|---|---|---|---|
| CAS Number | 1642801-68-0 | Molecular Weight | 210.66 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C10H11ClN2O | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | 6-Chloro-1,3,3-trimethyl-1H,2H,3H-pyrrolo[3,2-c]pyridin-2-one |
|---|
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C10H11ClN2O |
|---|---|
| Molecular Weight | 210.66 |
| InChIKey | SBMQJHIIQHMWNR-UHFFFAOYSA-N |
| SMILES | CN1C(=O)C(C)(C)c2cnc(Cl)cc21 |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the molecular weight of 6-Chloro-1,3,3-trimethyl-1H,2H,3H-pyrrolo[3,2-c]pyridin-2-one? |
| A: Molecular weight of 6-Chloro-1,3,3-trimethyl-1H,2H,3H-pyrrolo[3,2-c]pyridin-2-one is 210.66. |
| Q: What is the InChIKey of 6-Chloro-1,3,3-trimethyl-1H,2H,3H-pyrrolo[3,2-c]pyridin-2-one? |
| A: InChIKey of 6-Chloro-1,3,3-trimethyl-1H,2H,3H-pyrrolo[3,2-c]pyridin-2-one is SBMQJHIIQHMWNR-UHFFFAOYSA-N. |
| Q: What is the molecular formula of 6-Chloro-1,3,3-trimethyl-1H,2H,3H-pyrrolo[3,2-c]pyridin-2-one? |
| A: Molecular formula of 6-Chloro-1,3,3-trimethyl-1H,2H,3H-pyrrolo[3,2-c]pyridin-2-one is C10H11ClN2O. |
| Q: What is the English name of 6-Chloro-1,3,3-trimethyl-1H,2H,3H-pyrrolo[3,2-c]pyridin-2-one? |
| A: The English name of 6-Chloro-1,3,3-trimethyl-1H,2H,3H-pyrrolo[3,2-c]pyridin-2-one is 6-Chloro-1,3,3-trimethyl-1H,2H,3H-pyrrolo[3,2-c]pyridin-2-one. |
| Q: What is the SMILES notation of 6-Chloro-1,3,3-trimethyl-1H,2H,3H-pyrrolo[3,2-c]pyridin-2-one? |
| A: SMILES notation of 6-Chloro-1,3,3-trimethyl-1H,2H,3H-pyrrolo[3,2-c]pyridin-2-one is CN1C(=O)C(C)(C)c2cnc(Cl)cc21. |
| Q: What is the Chinese name of 1642801-68-0? |
| A: Chinese name of 1642801-68-0 is 1642801-68-0. |
| Q: What is the CAS number of 6-Chloro-1,3,3-trimethyl-1H,2H,3H-pyrrolo[3,2-c]pyridin-2-one? |
| A: CAS number of 6-Chloro-1,3,3-trimethyl-1H,2H,3H-pyrrolo[3,2-c]pyridin-2-one is 1642801-68-0. |