9-(4,6-Diphenyl-1,3,5-triazin-2-yl)-1,3,6-triphenylcarbazole
Modify Date: 2026-09-26 16:31:41
9-(4,6-Diphenyl-1,3,5-triazin-2-yl)-1,3,6-triphenylcarbazole structure
|
Common Name | 9-(4,6-Diphenyl-1,3,5-triazin-2-yl)-1,3,6-triphenylcarbazole | ||
|---|---|---|---|---|
| CAS Number | 1642825-42-0 | Molecular Weight | 626.7 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C45H30N4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | 9-(4,6-Diphenyl-1,3,5-triazin-2-yl)-1,3,6-triphenylcarbazole |
|---|
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C45H30N4 |
|---|---|
| Molecular Weight | 626.7 |
| InChIKey | DQRPGNSENYHDEA-UHFFFAOYSA-N |
| SMILES | c1ccc(-c2ccc3c(c2)c2cc(-c4ccccc4)cc(-c4ccccc4)c2n3-c2nc(-c3ccccc3)nc(-c3ccccc3)n2)cc1 |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the CAS number of 9-(4,6-Diphenyl-1,3,5-triazin-2-yl)-1,3,6-triphenylcarbazole? |
| A: CAS number of 9-(4,6-Diphenyl-1,3,5-triazin-2-yl)-1,3,6-triphenylcarbazole is 1642825-42-0. |
| Q: What is the molecular weight of 9-(4,6-Diphenyl-1,3,5-triazin-2-yl)-1,3,6-triphenylcarbazole? |
| A: Molecular weight of 9-(4,6-Diphenyl-1,3,5-triazin-2-yl)-1,3,6-triphenylcarbazole is 626.7. |
| Q: What is the molecular formula of 9-(4,6-Diphenyl-1,3,5-triazin-2-yl)-1,3,6-triphenylcarbazole? |
| A: Molecular formula of 9-(4,6-Diphenyl-1,3,5-triazin-2-yl)-1,3,6-triphenylcarbazole is C45H30N4. |
| Q: What is the InChIKey of 9-(4,6-Diphenyl-1,3,5-triazin-2-yl)-1,3,6-triphenylcarbazole? |
| A: InChIKey of 9-(4,6-Diphenyl-1,3,5-triazin-2-yl)-1,3,6-triphenylcarbazole is DQRPGNSENYHDEA-UHFFFAOYSA-N. |
| Q: What is the English name of 9-(4,6-Diphenyl-1,3,5-triazin-2-yl)-1,3,6-triphenylcarbazole? |
| A: The English name of 9-(4,6-Diphenyl-1,3,5-triazin-2-yl)-1,3,6-triphenylcarbazole is 9-(4,6-Diphenyl-1,3,5-triazin-2-yl)-1,3,6-triphenylcarbazole. |
| Q: What is the SMILES notation of 9-(4,6-Diphenyl-1,3,5-triazin-2-yl)-1,3,6-triphenylcarbazole? |
| A: SMILES notation of 9-(4,6-Diphenyl-1,3,5-triazin-2-yl)-1,3,6-triphenylcarbazole is c1ccc(-c2ccc3c(c2)c2cc(-c4ccccc4)cc(-c4ccccc4)c2n3-c2nc(-c3ccccc3)nc(-c3ccccc3)n2)cc1. |
| Q: What is the Chinese name of 1642825-42-0? |
| A: Chinese name of 1642825-42-0 is 1642825-42-0. |