(S)-tert-Butyl 6-(cyanomethyl)tetrahydro-2H-pyran-3-ylcarbamate
Modify Date: 2025-09-09 14:19:16
(S)-tert-Butyl 6-(cyanomethyl)tetrahydro-2H-pyran-3-ylcarbamate structure
|
Common Name | (S)-tert-Butyl 6-(cyanomethyl)tetrahydro-2H-pyran-3-ylcarbamate | ||
|---|---|---|---|---|
| CAS Number | 1643951-95-4 | Molecular Weight | 240.30 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C12H20N2O3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | (S)-tert-Butyl 6-(cyanomethyl)tetrahydro-2H-pyran-3-ylcarbamate |
|---|
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C12H20N2O3 |
|---|---|
| Molecular Weight | 240.30 |
| InChIKey | QXCIJSZJDKXLQU-RGURZIINSA-N |
| SMILES | CC(C)(C)OC(=O)NC1CCC(CC#N)OC1 |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the molecular formula of (S)-tert-Butyl 6-(cyanomethyl)tetrahydro-2H-pyran-3-ylcarbamate? |
| A: Molecular formula of (S)-tert-Butyl 6-(cyanomethyl)tetrahydro-2H-pyran-3-ylcarbamate is C12H20N2O3. |
| Q: What is the SMILES notation of (S)-tert-Butyl 6-(cyanomethyl)tetrahydro-2H-pyran-3-ylcarbamate? |
| A: SMILES notation of (S)-tert-Butyl 6-(cyanomethyl)tetrahydro-2H-pyran-3-ylcarbamate is CC(C)(C)OC(=O)NC1CCC(CC#N)OC1. |
| Q: What is the CAS number of (S)-tert-Butyl 6-(cyanomethyl)tetrahydro-2H-pyran-3-ylcarbamate? |
| A: CAS number of (S)-tert-Butyl 6-(cyanomethyl)tetrahydro-2H-pyran-3-ylcarbamate is 1643951-95-4. |
| Q: What is the InChIKey of (S)-tert-Butyl 6-(cyanomethyl)tetrahydro-2H-pyran-3-ylcarbamate? |
| A: InChIKey of (S)-tert-Butyl 6-(cyanomethyl)tetrahydro-2H-pyran-3-ylcarbamate is QXCIJSZJDKXLQU-RGURZIINSA-N. |
| Q: What is the English name of (S)-tert-Butyl 6-(cyanomethyl)tetrahydro-2H-pyran-3-ylcarbamate? |
| A: The English name of (S)-tert-Butyl 6-(cyanomethyl)tetrahydro-2H-pyran-3-ylcarbamate is (S)-tert-Butyl 6-(cyanomethyl)tetrahydro-2H-pyran-3-ylcarbamate. |
| Q: What is the molecular weight of (S)-tert-Butyl 6-(cyanomethyl)tetrahydro-2H-pyran-3-ylcarbamate? |
| A: Molecular weight of (S)-tert-Butyl 6-(cyanomethyl)tetrahydro-2H-pyran-3-ylcarbamate is 240.30. |
| Q: What is the Chinese name of 1643951-95-4? |
| A: Chinese name of 1643951-95-4 is 1643951-95-4. |