9H-Fluorene,9-bromo-2-fluoro-7-nitro
9H-Fluorene,9-bromo-2-fluoro-7-nitro structure
|
Common Name | 9H-Fluorene,9-bromo-2-fluoro-7-nitro | ||
|---|---|---|---|---|
| CAS Number | 1644-55-9 | Molecular Weight | 308.10300 | |
| Density | 1.723g/cm3 | Boiling Point | 387.6ºC at 760mmHg | |
| Molecular Formula | C13H7BrFNO2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 188.2ºC | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | 9-bromo-2-fluoro-7-nitro-9H-fluorene |
|---|---|
| Synonym | More Synonyms |
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Density | 1.723g/cm3 |
|---|---|
| Boiling Point | 387.6ºC at 760mmHg |
| Molecular Formula | C13H7BrFNO2 |
| Molecular Weight | 308.10300 |
| Flash Point | 188.2ºC |
| Exact Mass | 306.96400 |
| PSA | 45.82000 |
| LogP | 4.72180 |
| Vapour Pressure | 7.28E-06mmHg at 25°C |
| Index of Refraction | 1.687 |
| InChIKey | BMDIBGFDJCEJLU-UHFFFAOYSA-N |
| SMILES | O=[N+]([O-])c1ccc2c(c1)C(Br)c1cc(F)ccc1-2 |
This table presents publicly reported synthetic routes, reaction conditions, reactants and product information of the compound.
|
~%
9H-Fluorene,9-b... CAS#:1644-55-9 |
| Literature: Pan,H.-L.; Fletcher,T.L. J. Med. Chem., 1964 , vol. 7, p. 31 - 38 |
This table lists upstream starting materials and downstream derivative products related to this chemical.
| Precursor 1 | |
|---|---|
| DownStream 0 | |
This table collects all English aliases, systematic names and CAS‑related synonyms of the compound.
| 9H-Fluorene,9-bromo-2-fluoro-7-nitro |
| 9-Brom-2-fluor-7-nitrofluoren |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the LogP of 9-bromo-2-fluoro-7-nitro-9H-fluorene? |
| A: LogP of 9-bromo-2-fluoro-7-nitro-9H-fluorene is 4.72180. |
| Q: What is the molecular weight of 9-bromo-2-fluoro-7-nitro-9H-fluorene? |
| A: Molecular weight of 9-bromo-2-fluoro-7-nitro-9H-fluorene is 308.10300. |
| Q: What is the InChIKey of 9-bromo-2-fluoro-7-nitro-9H-fluorene? |
| A: InChIKey of 9-bromo-2-fluoro-7-nitro-9H-fluorene is BMDIBGFDJCEJLU-UHFFFAOYSA-N. |
| Q: What is the CAS number of 9-bromo-2-fluoro-7-nitro-9H-fluorene? |
| A: CAS number of 9-bromo-2-fluoro-7-nitro-9H-fluorene is 1644-55-9. |
| Q: What are the upstream materials of 9-bromo-2-fluoro-7-nitro-9H-fluorene? |
| A: Related upstream materials(CAS) of 9-bromo-2-fluoro-7-nitro-9H-fluorene: 1806-25-3. |
| Q: What is the polar surface area (PSA) of 9-bromo-2-fluoro-7-nitro-9H-fluorene? |
| A: Polar surface area (PSA) of 9-bromo-2-fluoro-7-nitro-9H-fluorene is 45.82000. |
| Q: What is the SMILES notation of 9-bromo-2-fluoro-7-nitro-9H-fluorene? |
| A: SMILES notation of 9-bromo-2-fluoro-7-nitro-9H-fluorene is O=[N+]([O-])c1ccc2c(c1)C(Br)c1cc(F)ccc1-2. |
| Q: What is the English name of 9-bromo-2-fluoro-7-nitro-9H-fluorene? |
| A: The English name of 9-bromo-2-fluoro-7-nitro-9H-fluorene is 9-bromo-2-fluoro-7-nitro-9H-fluorene. |
| Q: What English synonyms does 9-bromo-2-fluoro-7-nitro-9H-fluorene have? |
| A: English synonyms of 9-bromo-2-fluoro-7-nitro-9H-fluorene: 9H-Fluorene,9-bromo-2-fluoro-7-nitro, 9-Brom-2-fluor-7-nitrofluoren. |
| Q: What is the boiling point of 9-bromo-2-fluoro-7-nitro-9H-fluorene? |
| A: Boiling point of 9-bromo-2-fluoro-7-nitro-9H-fluorene is 387.6ºC at 760mmHg. |
This table lists manufacturers and suppliers of this compound, including vendor names and product supply reference information.
| Dayang Chem (Hangzhou) Co., Ltd. |