(1S,2S)-2-(2,4-Dichlorophenyl)cyclobutan-1-amine hydrochloride
Modify Date: 2025-09-09 17:31:41
(1S,2S)-2-(2,4-Dichlorophenyl)cyclobutan-1-amine hydrochloride structure
|
Common Name | (1S,2S)-2-(2,4-Dichlorophenyl)cyclobutan-1-amine hydrochloride | ||
|---|---|---|---|---|
| CAS Number | 1644255-10-6 | Molecular Weight | 252.6 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C10H12Cl3N | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | (1S,2S)-2-(2,4-Dichlorophenyl)cyclobutan-1-amine hydrochloride |
|---|
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C10H12Cl3N |
|---|---|
| Molecular Weight | 252.6 |
| InChIKey | DNGOUCBKEBQGFE-GNAZCLTHSA-N |
| SMILES | Cl.NC1CCC1c1ccc(Cl)cc1Cl |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the SMILES notation of (1S,2S)-2-(2,4-Dichlorophenyl)cyclobutan-1-amine hydrochloride? |
| A: SMILES notation of (1S,2S)-2-(2,4-Dichlorophenyl)cyclobutan-1-amine hydrochloride is Cl.NC1CCC1c1ccc(Cl)cc1Cl. |
| Q: What is the English name of (1S,2S)-2-(2,4-Dichlorophenyl)cyclobutan-1-amine hydrochloride? |
| A: The English name of (1S,2S)-2-(2,4-Dichlorophenyl)cyclobutan-1-amine hydrochloride is (1S,2S)-2-(2,4-Dichlorophenyl)cyclobutan-1-amine hydrochloride. |
| Q: What is the molecular formula of (1S,2S)-2-(2,4-Dichlorophenyl)cyclobutan-1-amine hydrochloride? |
| A: Molecular formula of (1S,2S)-2-(2,4-Dichlorophenyl)cyclobutan-1-amine hydrochloride is C10H12Cl3N. |
| Q: What is the molecular weight of (1S,2S)-2-(2,4-Dichlorophenyl)cyclobutan-1-amine hydrochloride? |
| A: Molecular weight of (1S,2S)-2-(2,4-Dichlorophenyl)cyclobutan-1-amine hydrochloride is 252.6. |
| Q: What is the CAS number of (1S,2S)-2-(2,4-Dichlorophenyl)cyclobutan-1-amine hydrochloride? |
| A: CAS number of (1S,2S)-2-(2,4-Dichlorophenyl)cyclobutan-1-amine hydrochloride is 1644255-10-6. |
| Q: What is the Chinese name of 1644255-10-6? |
| A: Chinese name of 1644255-10-6 is 1644255-10-6. |
| Q: What is the InChIKey of (1S,2S)-2-(2,4-Dichlorophenyl)cyclobutan-1-amine hydrochloride? |
| A: InChIKey of (1S,2S)-2-(2,4-Dichlorophenyl)cyclobutan-1-amine hydrochloride is DNGOUCBKEBQGFE-GNAZCLTHSA-N. |