Dihydro Dutasteride structure
|
Common Name | Dihydro Dutasteride | ||
|---|---|---|---|---|
| CAS Number | 164656-22-8 | Molecular Weight | 530.54600 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C27H32F6N2O2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
Use of Dihydro DutasterideDihydro Dutasteride is a metabolite of Dutasteride. Dutasteride is a potent inhibitor of both 5 alpha-reductase isozymes[1]. |
| Name | (5α,17β)-N-[2,5-bis(trifluoromethyl)-phenyl]-3-oxo-4-aza-5-androstane-17-carboxamide |
|---|---|
| Synonym | More Synonyms |
| Description | Dihydro Dutasteride is a metabolite of Dutasteride. Dutasteride is a potent inhibitor of both 5 alpha-reductase isozymes[1]. |
|---|---|
| Related Catalog | |
| References |
| Molecular Formula | C27H32F6N2O2 |
|---|---|
| Molecular Weight | 530.54600 |
| Exact Mass | 530.23700 |
| PSA | 58.20000 |
| LogP | 7.20190 |
| InChIKey | AIUHDIPAGREENV-QWBYCMEYSA-N |
| SMILES | CC12CCC(=O)NC1CCC1C2CCC2(C)C(C(=O)Nc3cc(C(F)(F)F)ccc3C(F)(F)F)CCC12 |
| Dihydro Dutasteride |
| Dutasteride Impurity 5 |