2,4-bis(diethylamino)-6-fluoro-pyrimidine structure
|
Common Name | 2,4-bis(diethylamino)-6-fluoro-pyrimidine | ||
|---|---|---|---|---|
| CAS Number | 1648-44-8 | Molecular Weight | 240.32000 | |
| Density | 1.082g/cm3 | Boiling Point | 349.4ºC at 760mmHg | |
| Molecular Formula | C12H21FN4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 165.1ºC | |
| Name | 2-N,2-N,4-N,4-N-tetraethyl-6-fluoropyrimidine-2,4-diamine |
|---|---|
| Synonym | More Synonyms |
| Density | 1.082g/cm3 |
|---|---|
| Boiling Point | 349.4ºC at 760mmHg |
| Molecular Formula | C12H21FN4 |
| Molecular Weight | 240.32000 |
| Flash Point | 165.1ºC |
| Exact Mass | 240.17500 |
| PSA | 32.26000 |
| LogP | 2.30810 |
| Vapour Pressure | 4.73E-05mmHg at 25°C |
| Index of Refraction | 1.539 |
| InChIKey | SUZKLEHYAYNQOC-UHFFFAOYSA-N |
| SMILES | CCN(CC)c1cc(F)nc(N(CC)CC)n1 |
| HS Code | 2933599090 |
|---|
| HS Code | 2933599090 |
|---|---|
| Summary | 2933599090. other compounds containing a pyrimidine ring (whether or not hydrogenated) or piperazine ring in the structure. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| N2,N2,N4,N4-tetraethyl-6-fluoropyrimidine-2,4-diamine |
| 2,3-DIMETHYL-5-(1-METHYLPROPYL)PYRAZINE 1-OXIDE |
| 2,4-BIS(DIETHYLAMINO)-6-FLUORO-PYRIMIDINE |
| QC-7160 |