3-oxobut-1-enyl(triphenyl)phosphanium,bromide
3-oxobut-1-enyl(triphenyl)phosphanium,bromide structure
|
Common Name | 3-oxobut-1-enyl(triphenyl)phosphanium,bromide | ||
|---|---|---|---|---|
| CAS Number | 16491-69-3 | Molecular Weight | 411.27100 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C22H20BrOP | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
Summary: 3-oxobut-1-enyl(triphenyl)phosphanium bromide, also known as 3-oxobut-1-enyl( triphenyl)phosphonium bromide, has a CAS number of 16491-69-3, with a molecular formula of C22H20BrOP and a molecular weight of 411.27100. For research-use only, not for medical or clinical usage.
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | 3-oxobut-1-enyl(triphenyl)phosphanium,bromide |
|---|---|
| Synonym | More Synonyms |
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C22H20BrOP |
|---|---|
| Molecular Weight | 411.27100 |
| Exact Mass | 410.04400 |
| PSA | 30.66000 |
| LogP | 1.08720 |
| InChIKey | MODRBGJVQSUOOY-UHFFFAOYSA-M |
| SMILES | CC(=O)C=C[P+](c1ccccc1)(c1ccccc1)c1ccccc1.[Br-] |
This table presents publicly reported synthetic routes, reaction conditions, reactants and product information of the compound.
|
~%
3-oxobut-1-enyl... CAS#:16491-69-3 |
| Literature: Zbiral,E.; Werner,E. Justus Liebigs Annalen der Chemie, 1967 , vol. 707, p. 130 - 140 |
This table collects all English aliases, systematic names and CAS‑related synonyms of the compound.
| Phosphonium,(3-oxo-1-butenyl)triphenyl-,bromide |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What English synonyms does 3-oxobut-1-enyl(triphenyl)phosphanium,bromide have? |
| A: English synonyms of 3-oxobut-1-enyl(triphenyl)phosphanium,bromide: Phosphonium,(3-oxo-1-butenyl)triphenyl-,bromide. |
| Q: What is the molecular weight of 3-oxobut-1-enyl(triphenyl)phosphanium,bromide? |
| A: Molecular weight of 3-oxobut-1-enyl(triphenyl)phosphanium,bromide is 411.27100. |
| Q: What is the molecular formula of 3-oxobut-1-enyl(triphenyl)phosphanium,bromide? |
| A: Molecular formula of 3-oxobut-1-enyl(triphenyl)phosphanium,bromide is C22H20BrOP. |
| Q: What is the InChIKey of 3-oxobut-1-enyl(triphenyl)phosphanium,bromide? |
| A: InChIKey of 3-oxobut-1-enyl(triphenyl)phosphanium,bromide is MODRBGJVQSUOOY-UHFFFAOYSA-M. |
| Q: What is the Chinese name of 16491-69-3? |
| A: Chinese name of 16491-69-3 is 16491-69-3. |
| Q: What is the SMILES notation of 3-oxobut-1-enyl(triphenyl)phosphanium,bromide? |
| A: SMILES notation of 3-oxobut-1-enyl(triphenyl)phosphanium,bromide is CC(=O)C=C[P+](c1ccccc1)(c1ccccc1)c1ccccc1.[Br-]. |
| Q: What is the polar surface area (PSA) of 3-oxobut-1-enyl(triphenyl)phosphanium,bromide? |
| A: Polar surface area (PSA) of 3-oxobut-1-enyl(triphenyl)phosphanium,bromide is 30.66000. |
| Q: What is the LogP of 3-oxobut-1-enyl(triphenyl)phosphanium,bromide? |
| A: LogP of 3-oxobut-1-enyl(triphenyl)phosphanium,bromide is 1.08720. |
| Q: What is the CAS number of 3-oxobut-1-enyl(triphenyl)phosphanium,bromide? |
| A: CAS number of 3-oxobut-1-enyl(triphenyl)phosphanium,bromide is 16491-69-3. |
| Q: What is the English name of 3-oxobut-1-enyl(triphenyl)phosphanium,bromide? |
| A: The English name of 3-oxobut-1-enyl(triphenyl)phosphanium,bromide is 3-oxobut-1-enyl(triphenyl)phosphanium,bromide. |