7-NITROBENZOFURAN-3(2H)-ONE structure
|
Common Name | 7-NITROBENZOFURAN-3(2H)-ONE | ||
|---|---|---|---|---|
| CAS Number | 164915-57-5 | Molecular Weight | 164.15800 | |
| Density | 1.262g/cm3 | Boiling Point | 300.8ºC at 760 mmHg | |
| Molecular Formula | C9H8O3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 126.6ºC | |
| Name | 7-Nitro-3(2H)-benzofuranone |
|---|---|
| Synonym | More Synonyms |
| Density | 1.262g/cm3 |
|---|---|
| Boiling Point | 300.8ºC at 760 mmHg |
| Molecular Formula | C9H8O3 |
| Molecular Weight | 164.15800 |
| Flash Point | 126.6ºC |
| Exact Mass | 164.04700 |
| PSA | 35.53000 |
| LogP | 1.27030 |
| Vapour Pressure | 0.00109mmHg at 25°C |
| Index of Refraction | 1.562 |
| InChIKey | JXPZMKPGHINWQC-UHFFFAOYSA-N |
| SMILES | O=C1COc2c1cccc2[N+](=O)[O-] |
| HS Code | 2932999099 |
|---|
|
~%
7-NITROBENZOFUR... CAS#:164915-57-5 |
| Literature: US5521147 A1, ; |
| HS Code | 2932999099 |
|---|---|
| Summary | 2932999099. other heterocyclic compounds with oxygen hetero-atom(s) only. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| 2,3-Dihydro-7-methyl-5-methylamino-8-nitroimidazo<1,2-c>pyrimidin |
| 2,3-dihydro-7-nitrobenzofuran-3-one |
| 2,3-dihydro-7-nitro-3-benzofuranone |