8-hydroxyquinoline-5-sulphonic acid, compound with 4-(dimethylamino)-1,2-dihydro-1,5-dimethyl-2-phenyl-3H-pyrazol-3-one (1:1) structure
|
Common Name | 8-hydroxyquinoline-5-sulphonic acid, compound with 4-(dimethylamino)-1,2-dihydro-1,5-dimethyl-2-phenyl-3H-pyrazol-3-one (1:1) | ||
|---|---|---|---|---|
| CAS Number | 16509-13-0 | Molecular Weight | 456.51500 | |
| Density | N/A | Boiling Point | 319.7ºC at 760 mmHg | |
| Molecular Formula | C22H24N4O5S | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 125.9ºC | |
| Name | 8-Hydroxy-5-quinolinesulfonic acid-4-(dimethylamino)-1,5-dimeth yl-2-phenyl-1,2-dihydro-3H-pyrazol-3-one (1:1) |
|---|
| Boiling Point | 319.7ºC at 760 mmHg |
|---|---|
| Molecular Formula | C22H24N4O5S |
| Molecular Weight | 456.51500 |
| Flash Point | 125.9ºC |
| Exact Mass | 456.14700 |
| PSA | 126.04000 |
| LogP | 3.81830 |
| Vapour Pressure | 0.000333mmHg at 25°C |
| InChIKey | XYPGQNOXGWPNHX-UHFFFAOYSA-N |
| SMILES | Cc1c(N(C)C)c(=O)n(-c2ccccc2)n1C.O=S(=O)(O)c1ccc(O)c2ncccc12 |