2,5-dihydroxybenzoic acid, compound with N4-(7-chloro-4-quinolyl)-N1,N1-diethylpentane-1,4-diamine structure
|
Common Name | 2,5-dihydroxybenzoic acid, compound with N4-(7-chloro-4-quinolyl)-N1,N1-diethylpentane-1,4-diamine | ||
|---|---|---|---|---|
| CAS Number | 16510-14-8 | Molecular Weight | 473.99200 | |
| Density | N/A | Boiling Point | 460.6ºC at 760 mmHg | |
| Molecular Formula | C25H32ClN3O4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 232.3ºC | |
| Name | 4-N-(7-chloroquinolin-4-yl)-1-N,1-N-diethylpentane-1,4-diamine,2,5-dihydroxybenzoic acid |
|---|---|
| Synonym | More Synonyms |
| Boiling Point | 460.6ºC at 760 mmHg |
|---|---|
| Molecular Formula | C25H32ClN3O4 |
| Molecular Weight | 473.99200 |
| Flash Point | 232.3ºC |
| Exact Mass | 473.20800 |
| PSA | 105.92000 |
| LogP | 5.67960 |
| Vapour Pressure | 1.15E-08mmHg at 25°C |
| InChIKey | NJAVYAZYVFVSRZ-UHFFFAOYSA-N |
| SMILES | CCN(CC)CCCC(C)Nc1ccnc2cc(Cl)ccc12.O=C(O)c1cc(O)ccc1O |
| 4-N-(7-chloroquinolin-4-yl)-1-N,1-N-diethylpentane-1,4-diamine |
| EINECS 240-578-3 |
| 2,5-Dihydroxybenzoic acid,compound with N4-(7-chloro-4-quinolyl)-N1,N1-diethylpentane-1,4-diamine |