1-amino-9,10-dihydro-4-hydroxy-9,10-dioxo-2-anthryl 4-ethoxybenzenesulphonate structure
|
Common Name | 1-amino-9,10-dihydro-4-hydroxy-9,10-dioxo-2-anthryl 4-ethoxybenzenesulphonate | ||
|---|---|---|---|---|
| CAS Number | 16517-80-9 | Molecular Weight | 439.43800 | |
| Density | 1.494g/cm3 | Boiling Point | 724.1ºC at 760mmHg | |
| Molecular Formula | C22H17NO7S | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 391.7ºC | |
| Name | (1-amino-4-hydroxy-9,10-dioxoanthracen-2-yl) 4-ethoxybenzenesulfonate |
|---|---|
| Synonym | More Synonyms |
| Density | 1.494g/cm3 |
|---|---|
| Boiling Point | 724.1ºC at 760mmHg |
| Molecular Formula | C22H17NO7S |
| Molecular Weight | 439.43800 |
| Flash Point | 391.7ºC |
| Exact Mass | 439.07300 |
| PSA | 141.37000 |
| LogP | 4.57820 |
| Vapour Pressure | 1.15E-21mmHg at 25°C |
| Index of Refraction | 1.673 |
| InChIKey | JNVVHAUTUNBSEZ-UHFFFAOYSA-N |
| SMILES | CCOc1ccc(S(=O)(=O)Oc2cc(O)c3c(c2N)C(=O)c2ccccc2C3=O)cc1 |
| HS Code | 2922509090 |
|---|
| HS Code | 2922509090 |
|---|---|
| Summary | 2922509090. other amino-alcohol-phenols, amino-acid-phenols and other amino-compounds with oxygen function. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |
| EINECS 240-583-0 |
| 1-amino-4-hydroxy-9,10-dioxo-9,10-dihydroanthracen-2-yl 4-ethoxybenzenesulfonate |
| 1-AMINO-9,10-DIHYDRO-4-HYDROXY-9,10-DIOXO-2-ANTHRYL 4-ETHOXYBENZENESULFONATE |