Ethane,1,1'-oxybis[2-(methylsulfonyl)- (9CI) structure
|
Common Name | Ethane,1,1'-oxybis[2-(methylsulfonyl)- (9CI) | ||
|---|---|---|---|---|
| CAS Number | 16523-03-8 | Molecular Weight | 230.30200 | |
| Density | 1.308g/cm3 | Boiling Point | 492.2ºC at 760mmHg | |
| Molecular Formula | C6H14O5S2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 251.5ºC | |
| Name | 1-methylsulfonyl-2-(2-methylsulfonylethoxy)ethane |
|---|---|
| Synonym | More Synonyms |
| Density | 1.308g/cm3 |
|---|---|
| Boiling Point | 492.2ºC at 760mmHg |
| Molecular Formula | C6H14O5S2 |
| Molecular Weight | 230.30200 |
| Flash Point | 251.5ºC |
| Exact Mass | 230.02800 |
| PSA | 94.27000 |
| LogP | 1.25380 |
| Vapour Pressure | 2.36E-09mmHg at 25°C |
| Index of Refraction | 1.471 |
| InChIKey | ZMKVRQZZSWXWMN-UHFFFAOYSA-N |
| SMILES | CS(=O)(=O)CCOCCS(C)(=O)=O |
|
~%
Ethane,1,1'-oxy... CAS#:16523-03-8 |
| Literature: Mamalis; Rydon Journal of the Chemical Society, 1955 , p. 1049,1055 |
| Precursor 1 | |
|---|---|
| DownStream 0 | |
| Bis-<2-methylsulfonyl-aethyl>-aether |