methoxytetramethyl cyclohexenyl methyl ketone structure
|
Common Name | methoxytetramethyl cyclohexenyl methyl ketone | ||
|---|---|---|---|---|
| CAS Number | 16556-48-2 | Molecular Weight | 210.31300 | |
| Density | 0.94g/cm3 | Boiling Point | 279.6ºC at 760mmHg | |
| Molecular Formula | C13H22O2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 102.3ºC | |
| Name | 1-(4-methoxy-2,2,6,6-tetramethylcyclohex-3-en-1-yl)ethanone |
|---|---|
| Synonym | More Synonyms |
| Density | 0.94g/cm3 |
|---|---|
| Boiling Point | 279.6ºC at 760mmHg |
| Molecular Formula | C13H22O2 |
| Molecular Weight | 210.31300 |
| Flash Point | 102.3ºC |
| Exact Mass | 210.16200 |
| PSA | 26.30000 |
| LogP | 3.17800 |
| Vapour Pressure | 0.00397mmHg at 25°C |
| Index of Refraction | 1.466 |
| InChIKey | ZGMRSDALCWKJIM-UHFFFAOYSA-N |
| SMILES | COC1=CC(C)(C)C(C(C)=O)C(C)(C)C1 |
| HS Code | 2914509090 |
|---|
| HS Code | 2914509090 |
|---|---|
| Summary | HS:2914509090 other ketones with other oxygen function VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:5.5% General tariff:30.0% |
| EINECS 240-621-6 |
| 1-Methoxy-3,3,5,5-tetramethyl-4-acetylcyclohexen |
| 4-Acetyl-1-methoxy-3,3,5,5-tetramethyl-1-cyclohexene |
| 4-acetyl-1-methoxy-3,3,5,5-tetramethylcyclo 1-hexene |
| 1-(4-Methoxy-2,2,6,6-tetramethyl-3-cyclohexen-1-yl)ethan-1-one |