Oxirane,2,2'-[thiobis(4,1-phenyleneoxymethylene)]bis- structure
|
Common Name | Oxirane,2,2'-[thiobis(4,1-phenyleneoxymethylene)]bis- | ||
|---|---|---|---|---|
| CAS Number | 16558-06-8 | Molecular Weight | 330.39800 | |
| Density | 1.32g/cm3 | Boiling Point | 525.8ºC at 760mmHg | |
| Molecular Formula | C18H18O4S | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 271.8ºC | |
| Name | 2-[[4-[4-(oxiran-2-ylmethoxy)phenyl]sulfanylphenoxy]methyl]oxirane |
|---|---|
| Synonym | More Synonyms |
| Density | 1.32g/cm3 |
|---|---|
| Boiling Point | 525.8ºC at 760mmHg |
| Molecular Formula | C18H18O4S |
| Molecular Weight | 330.39800 |
| Flash Point | 271.8ºC |
| Exact Mass | 330.09300 |
| PSA | 68.82000 |
| LogP | 3.39300 |
| Vapour Pressure | 1.28E-10mmHg at 25°C |
| Index of Refraction | 1.64 |
| InChIKey | HIPITKSLDBPUIB-UHFFFAOYSA-N |
| SMILES | c1cc(Sc2ccc(OCC3CO3)cc2)ccc1OCC1CO1 |
|
~21%
Oxirane,2,2'-[t... CAS#:16558-06-8 |
| Literature: BRITISH COLUMBIA CANCER AGENCY BRANCH; THE UNIVERSITY OF BRITISH COLUMBIA; SADAR, Marianne D.; MAWJI, Nasrin R.; BANUELOS, Carmen Adriana; ANDERSEN, Raymond J.; GARCIA FERNANDEZ, Javier Patent: WO2011/82488 A1, 2011 ; Location in patent: Page/Page column 99 ; |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| 4,4'-thiodiphenol diglycidyl ether |