indeno[2,1-c]pyrazol-8(2H)-one
Modify Date: 2026-06-10 18:40:34
![indeno[2,1-c]pyrazol-8(2H)-one Structure](https://www.chemsrc.com/extcaspic/230/165686-44-2.png)
indeno[2,1-c]pyrazol-8(2H)-one structure
|
Common Name | indeno[2,1-c]pyrazol-8(2H)-one | ||
|---|---|---|---|---|
| CAS Number | 165686-44-2 | Molecular Weight | 170.17 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C10H6N2O | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | indeno[2,1-c]pyrazol-8(2H)-one |
|---|
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C10H6N2O |
|---|---|
| Molecular Weight | 170.17 |
| InChIKey | BPMLDDSWSPCZKS-UHFFFAOYSA-N |
| SMILES | C1=CC=C2C(=C1)C3=C(C2=O)NN=C3 |
This table contains target information, in‑vitro & in‑vivo assay data for this compound.
|
Name: Cytotoxicity against human HeLa cells assessed as reduction in cell viability incubat...
Source: ChEMBL
Target: HeLa
External Id: CHEMBL4614038
|
|
Name: Inhibition of HIF1alpha transcriptional activity in human HeLa cells transfected with...
Source: ChEMBL
Target: Hypoxia-inducible factor 1-alpha
External Id: CHEMBL4614037
|
Total 3, Current Page 1 of 1
1
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the English name of indeno[2,1-c]pyrazol-8(2H)-one? |
| A: The English name of indeno[2,1-c]pyrazol-8(2H)-one is indeno[2,1-c]pyrazol-8(2H)-one. |
| Q: What is the CAS number of indeno[2,1-c]pyrazol-8(2H)-one? |
| A: CAS number of indeno[2,1-c]pyrazol-8(2H)-one is 165686-44-2. |
| Q: What is the SMILES notation of indeno[2,1-c]pyrazol-8(2H)-one? |
| A: SMILES notation of indeno[2,1-c]pyrazol-8(2H)-one is C1=CC=C2C(=C1)C3=C(C2=O)NN=C3. |
| Q: What is the InChIKey of indeno[2,1-c]pyrazol-8(2H)-one? |
| A: InChIKey of indeno[2,1-c]pyrazol-8(2H)-one is BPMLDDSWSPCZKS-UHFFFAOYSA-N. |
| Q: What is the Chinese name of 165686-44-2? |
| A: Chinese name of 165686-44-2 is 165686-44-2. |
| Q: What is the molecular formula of indeno[2,1-c]pyrazol-8(2H)-one? |
| A: Molecular formula of indeno[2,1-c]pyrazol-8(2H)-one is C10H6N2O. |
| Q: What is the molecular weight of indeno[2,1-c]pyrazol-8(2H)-one? |
| A: Molecular weight of indeno[2,1-c]pyrazol-8(2H)-one is 170.17. |