Loratadine Impurity 3 structure
|
Common Name | Loratadine Impurity 3 | ||
|---|---|---|---|---|
| CAS Number | 165739-83-3 | Molecular Weight | 417.32800 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C22H22Cl2N2O2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
Use of Loratadine Impurity 34-Chloroloratadine is an impurity of Loratadine. |
| Name | 4-Chloro Loratadine |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C22H22Cl2N2O2 |
|---|---|
| Molecular Weight | 417.32800 |
| Exact Mass | 416.10600 |
| PSA | 45.33000 |
| LogP | 5.13530 |
| InChIKey | LOTMYBFPXGPIDD-UHFFFAOYSA-N |
| SMILES | CCOC(=O)N1CCC(=C2c3ccc(Cl)cc3CCc3c(Cl)ccnc32)CC1 |
| ethyl 4-(4,8-dichloro-5,6-dihydrobenzo[4,5]cyclohepta[1,2-b]pyridin-11-ylidene)piperidine-1-carboxylate |
| Loratadine Impurity 3 |