3-Trimethylsilyl-1-propylboronic acid pinacol ester, 94% structure
|
Common Name | 3-Trimethylsilyl-1-propylboronic acid pinacol ester, 94% | ||
|---|---|---|---|---|
| CAS Number | 165904-32-5 | Molecular Weight | 242.23800 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C12H27BO2Si | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 3-Trimethylsilyl-1-propylboronic acid pinacol ester, 94% |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C12H27BO2Si |
|---|---|
| Molecular Weight | 242.23800 |
| Exact Mass | 242.18700 |
| PSA | 18.46000 |
| LogP | 3.80690 |
| InChIKey | SVYVMKANVAUFQP-UHFFFAOYSA-N |
| SMILES | CC1(C)OB(CCC[Si](C)(C)C)OC1(C)C |
|
~98%
3-Trimethylsily... CAS#:165904-32-5 |
| Literature: Pereira, Schubert; Srebnik, Morris Journal of the American Chemical Society, 1996 , vol. 118, # 4 p. 909 - 910 |
|
~68%
3-Trimethylsily... CAS#:165904-32-5 |
| Literature: Gong, Tian-Jun; Jiang, Yuan-Ye; Fu, Yao Chinese Chemical Letters, 2014 , vol. 25, # 3 p. 397 - 400 |
| 2-ethenoxyethyl(trimethyl)azanium iodide |
| trimethyl-(2-vinyloxy-ethyl)-ammonium,iodide |
| AMMONIUM,TRIMETHYL(2-VINYLOXYETHYL)-,IODIDE |
| Vinyl ether of trimethyl-2-hydroxyethylammonium iodide |
| Trimethyl-(2-vinyloxy-aethyl)-ammonium,Jodid |
| trimethyl(3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-propyl)silane |