Benzenesulfonothioicacid, 4-methyl-, S-(phenylmethyl) ester structure
|
Common Name | Benzenesulfonothioicacid, 4-methyl-, S-(phenylmethyl) ester | ||
|---|---|---|---|---|
| CAS Number | 16601-02-8 | Molecular Weight | 278.39000 | |
| Density | 1.253g/cm3 | Boiling Point | 430.8ºC at 760mmHg | |
| Molecular Formula | C14H14O2S2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 214.4ºC | |
| Name | 1-benzylsulfanylsulfonyl-4-methylbenzene |
|---|---|
| Synonym | More Synonyms |
| Density | 1.253g/cm3 |
|---|---|
| Boiling Point | 430.8ºC at 760mmHg |
| Molecular Formula | C14H14O2S2 |
| Molecular Weight | 278.39000 |
| Flash Point | 214.4ºC |
| Exact Mass | 278.04400 |
| PSA | 67.82000 |
| LogP | 4.69790 |
| Vapour Pressure | 3.16E-07mmHg at 25°C |
| Index of Refraction | 1.615 |
| InChIKey | AJHXMWXYVYOBQI-UHFFFAOYSA-N |
| SMILES | Cc1ccc(S(=O)(=O)SCc2ccccc2)cc1 |
| Precursor 9 | |
|---|---|
| DownStream 4 | |
|
Name: Inhibition of human serum BuChE using butyrylthiocholine iodide as substrate preincub...
Source: ChEMBL
Target: Cholinesterase
External Id: CHEMBL4822910
|
|
Name: Inhibition of human recombinant AChE using acetylthiocholine iodide as substrate prei...
Source: ChEMBL
Target: Acetylcholinesterase
External Id: CHEMBL4822909
|
| toluene-4-thiosulfonic acid S-benzyl ester |
| S-benzyl 4-methylbenzenethiosulfonate |
| [(4-methylphenyl)sulfonyl]benzylthio |
| benzyl thiotosylate |
| Toluol-4-thiosulfonsaeure-S-benzylester |
| S-Benzyl 4-methylbenzenesulfonothioate |
| benzenesulfonothioic acid S-benzyl ester |