3-(Benzylsulfanyl)pentane-2,4-dione
Modify Date: 2025-09-10 23:51:46
3-(Benzylsulfanyl)pentane-2,4-dione structure
|
Common Name | 3-(Benzylsulfanyl)pentane-2,4-dione | ||
|---|---|---|---|---|
| CAS Number | 16601-30-2 | Molecular Weight | 222.31 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C12H14O2S | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | 3-(Benzylsulfanyl)pentane-2,4-dione |
|---|
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C12H14O2S |
|---|---|
| Molecular Weight | 222.31 |
| InChIKey | BQBHNYXOXPLCDV-UHFFFAOYSA-N |
| SMILES | CC(=O)C(SCc1ccccc1)C(C)=O |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the molecular formula of 3-(Benzylsulfanyl)pentane-2,4-dione? |
| A: Molecular formula of 3-(Benzylsulfanyl)pentane-2,4-dione is C12H14O2S. |
| Q: What is the molecular weight of 3-(Benzylsulfanyl)pentane-2,4-dione? |
| A: Molecular weight of 3-(Benzylsulfanyl)pentane-2,4-dione is 222.31. |
| Q: What is the SMILES notation of 3-(Benzylsulfanyl)pentane-2,4-dione? |
| A: SMILES notation of 3-(Benzylsulfanyl)pentane-2,4-dione is CC(=O)C(SCc1ccccc1)C(C)=O. |
| Q: What is the English name of 3-(Benzylsulfanyl)pentane-2,4-dione? |
| A: The English name of 3-(Benzylsulfanyl)pentane-2,4-dione is 3-(Benzylsulfanyl)pentane-2,4-dione. |
| Q: What is the CAS number of 3-(Benzylsulfanyl)pentane-2,4-dione? |
| A: CAS number of 3-(Benzylsulfanyl)pentane-2,4-dione is 16601-30-2. |
| Q: What is the Chinese name of 16601-30-2? |
| A: Chinese name of 16601-30-2 is 16601-30-2. |
| Q: What is the InChIKey of 3-(Benzylsulfanyl)pentane-2,4-dione? |
| A: InChIKey of 3-(Benzylsulfanyl)pentane-2,4-dione is BQBHNYXOXPLCDV-UHFFFAOYSA-N. |