2,6-dichloro-4-(1H-1,2,4-triazol-1-yl)pyridine
Modify Date: 2026-07-16 19:19:56
2,6-dichloro-4-(1H-1,2,4-triazol-1-yl)pyridine structure
|
Common Name | 2,6-dichloro-4-(1H-1,2,4-triazol-1-yl)pyridine | ||
|---|---|---|---|---|
| CAS Number | 1660116-98-2 | Molecular Weight | 215.04 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C7H4Cl2N4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | 2,6-dichloro-4-(1H-1,2,4-triazol-1-yl)pyridine |
|---|
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C7H4Cl2N4 |
|---|---|
| Molecular Weight | 215.04 |
| InChIKey | RTOLCAUBCDIHSO-UHFFFAOYSA-N |
| SMILES | Clc1cc(-n2cncn2)cc(Cl)n1 |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the CAS number of 2,6-dichloro-4-(1H-1,2,4-triazol-1-yl)pyridine? |
| A: CAS number of 2,6-dichloro-4-(1H-1,2,4-triazol-1-yl)pyridine is 1660116-98-2. |
| Q: What is the molecular weight of 2,6-dichloro-4-(1H-1,2,4-triazol-1-yl)pyridine? |
| A: Molecular weight of 2,6-dichloro-4-(1H-1,2,4-triazol-1-yl)pyridine is 215.04. |
| Q: What is the SMILES notation of 2,6-dichloro-4-(1H-1,2,4-triazol-1-yl)pyridine? |
| A: SMILES notation of 2,6-dichloro-4-(1H-1,2,4-triazol-1-yl)pyridine is Clc1cc(-n2cncn2)cc(Cl)n1. |
| Q: What is the English name of 2,6-dichloro-4-(1H-1,2,4-triazol-1-yl)pyridine? |
| A: The English name of 2,6-dichloro-4-(1H-1,2,4-triazol-1-yl)pyridine is 2,6-dichloro-4-(1H-1,2,4-triazol-1-yl)pyridine. |
| Q: What is the molecular formula of 2,6-dichloro-4-(1H-1,2,4-triazol-1-yl)pyridine? |
| A: Molecular formula of 2,6-dichloro-4-(1H-1,2,4-triazol-1-yl)pyridine is C7H4Cl2N4. |
| Q: What is the Chinese name of 1660116-98-2? |
| A: Chinese name of 1660116-98-2 is 1660116-98-2. |
| Q: What is the InChIKey of 2,6-dichloro-4-(1H-1,2,4-triazol-1-yl)pyridine? |
| A: InChIKey of 2,6-dichloro-4-(1H-1,2,4-triazol-1-yl)pyridine is RTOLCAUBCDIHSO-UHFFFAOYSA-N. |