1-(3,4,5-Trimethoxy-α-methylphenethyl)hydrazine structure
|
Common Name | 1-(3,4,5-Trimethoxy-α-methylphenethyl)hydrazine | ||
|---|---|---|---|---|
| CAS Number | 16603-10-4 | Molecular Weight | 240.29900 | |
| Density | 1.074g/cm3 | Boiling Point | 385.7ºC at 760mmHg | |
| Molecular Formula | C12H20N2O3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 187.1ºC | |
| Name | 1-(3,4,5-trimethoxyphenyl)propan-2-ylhydrazine |
|---|---|
| Synonym | More Synonyms |
| Density | 1.074g/cm3 |
|---|---|
| Boiling Point | 385.7ºC at 760mmHg |
| Molecular Formula | C12H20N2O3 |
| Molecular Weight | 240.29900 |
| Flash Point | 187.1ºC |
| Exact Mass | 240.14700 |
| PSA | 65.74000 |
| LogP | 2.19790 |
| Vapour Pressure | 3.74E-06mmHg at 25°C |
| Index of Refraction | 1.516 |
| InChIKey | CHXQMYIAXRURDN-UHFFFAOYSA-N |
| SMILES | COc1cc(CC(C)NN)cc(OC)c1OC |
| HS Code | 2928000090 |
|---|
| HS Code | 2928000090 |
|---|---|
| Summary | 2928000090 other organic derivatives of hydrazine or of hydroxylamine VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:6.5% General tariff:20.0% |
| 1-(3,4,5-Trimethoxyphenyl)-2-propylhydrazin |
| [1-Methyl-2-(3,4,5-trimethoxy-phenyl)-aethyl]-hydrazin |
| [1-methyl-2-(3,4,5-trimethoxy-phenyl)-ethyl]-hydrazine |