3-(4-chlorophenyl)-2-dimethylamino-3-oxo-propanenitrile structure
|
Common Name | 3-(4-chlorophenyl)-2-dimethylamino-3-oxo-propanenitrile | ||
|---|---|---|---|---|
| CAS Number | 16607-57-1 | Molecular Weight | 222.67100 | |
| Density | 1.213g/cm3 | Boiling Point | 378.8ºC at 760 mmHg | |
| Molecular Formula | C11H11ClN2O | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 182.9ºC | |
| Name | 3-(4-chlorophenyl)-2-(dimethylamino)-3-oxopropanenitrile |
|---|
| Density | 1.213g/cm3 |
|---|---|
| Boiling Point | 378.8ºC at 760 mmHg |
| Molecular Formula | C11H11ClN2O |
| Molecular Weight | 222.67100 |
| Flash Point | 182.9ºC |
| Exact Mass | 222.05600 |
| PSA | 44.10000 |
| LogP | 1.97648 |
| Vapour Pressure | 6.15E-06mmHg at 25°C |
| Index of Refraction | 1.552 |
| InChIKey | VUHFBNFIKJJYKD-UHFFFAOYSA-N |
| SMILES | CN(C)C(C#N)C(=O)c1ccc(Cl)cc1 |
|
~%
3-(4-chlorophen... CAS#:16607-57-1 |
| Literature: Smith,R.E. et al. Journal of Organic Chemistry, 1968 , vol. 33, # 6 p. 2562 - 2564 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |