Benzene,1-chloro-3-[2,2-dichloro-1-(4-iodophenyl)ethyl]- structure
|
Common Name | Benzene,1-chloro-3-[2,2-dichloro-1-(4-iodophenyl)ethyl]- | ||
|---|---|---|---|---|
| CAS Number | 16608-70-1 | Molecular Weight | 411.49300 | |
| Density | 1.691g/cm3 | Boiling Point | 427ºC at 760mmHg | |
| Molecular Formula | C14H10Cl3I | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 212ºC | |
| Name | 1-chloro-3-[2,2-dichloro-1-(4-iodophenyl)ethyl]benzene |
|---|---|
| Synonym | More Synonyms |
| Density | 1.691g/cm3 |
|---|---|
| Boiling Point | 427ºC at 760mmHg |
| Molecular Formula | C14H10Cl3I |
| Molecular Weight | 411.49300 |
| Flash Point | 212ºC |
| Exact Mass | 409.88900 |
| LogP | 5.88020 |
| Vapour Pressure | 4.23E-07mmHg at 25°C |
| Index of Refraction | 1.64 |
| InChIKey | AGDVNCQNAITBNZ-UHFFFAOYSA-N |
| SMILES | Clc1cccc(C(c2ccc(I)cc2)C(Cl)Cl)c1 |
|
~%
Benzene,1-chlor... CAS#:16608-70-1 |
| Literature: Counsell; Willette; DiGuilio Journal of medicinal chemistry, 1967 , vol. 10, # 5 p. 975 - 977 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| 1,1-Dichlor-2-(m-chlorphenyl)-2-(p-iodphenyl)ethan |
| Benzene,1-chloro-3-[2,2-dichloro-1-(4-iodophenyl)ethyl] |