3-{[(Tert-butoxy)carbonyl](octyl)amino}propanoic acid
Modify Date: 2026-08-06 12:19:01
amino}propanoic acid Structure](https://www.chemsrc.com/extcaspic/145/1661041-29-7.png)
3-{[(Tert-butoxy)carbonyl](octyl)amino}propanoic acid structure
|
Common Name | 3-{[(Tert-butoxy)carbonyl](octyl)amino}propanoic acid | ||
|---|---|---|---|---|
| CAS Number | 1661041-29-7 | Molecular Weight | 301.42 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C16H31NO4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | 3-{[(Tert-butoxy)carbonyl](octyl)amino}propanoic acid |
|---|
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C16H31NO4 |
|---|---|
| Molecular Weight | 301.42 |
| InChIKey | WJFPFUDNLMNYCG-UHFFFAOYSA-N |
| SMILES | CCCCCCCCN(CCC(=O)O)C(=O)OC(C)(C)C |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the InChIKey of 3-{[(Tert-butoxy)carbonyl](octyl)amino}propanoic acid? |
| A: InChIKey of 3-{[(Tert-butoxy)carbonyl](octyl)amino}propanoic acid is WJFPFUDNLMNYCG-UHFFFAOYSA-N. |
| Q: What is the CAS number of 3-{[(Tert-butoxy)carbonyl](octyl)amino}propanoic acid? |
| A: CAS number of 3-{[(Tert-butoxy)carbonyl](octyl)amino}propanoic acid is 1661041-29-7. |
| Q: What is the English name of 3-{[(Tert-butoxy)carbonyl](octyl)amino}propanoic acid? |
| A: The English name of 3-{[(Tert-butoxy)carbonyl](octyl)amino}propanoic acid is 3-{[(Tert-butoxy)carbonyl](octyl)amino}propanoic acid. |
| Q: What is the Chinese name of 1661041-29-7? |
| A: Chinese name of 1661041-29-7 is 1661041-29-7. |
| Q: What is the molecular formula of 3-{[(Tert-butoxy)carbonyl](octyl)amino}propanoic acid? |
| A: Molecular formula of 3-{[(Tert-butoxy)carbonyl](octyl)amino}propanoic acid is C16H31NO4. |
| Q: What is the SMILES notation of 3-{[(Tert-butoxy)carbonyl](octyl)amino}propanoic acid? |
| A: SMILES notation of 3-{[(Tert-butoxy)carbonyl](octyl)amino}propanoic acid is CCCCCCCCN(CCC(=O)O)C(=O)OC(C)(C)C. |
| Q: What is the molecular weight of 3-{[(Tert-butoxy)carbonyl](octyl)amino}propanoic acid? |
| A: Molecular weight of 3-{[(Tert-butoxy)carbonyl](octyl)amino}propanoic acid is 301.42. |