1-Propanone,2,3-dichloro-1,3-diphenyl
Modify Date: 2025-11-26 07:51:06
1-Propanone,2,3-dichloro-1,3-diphenyl structure
|
Common Name | 1-Propanone,2,3-dichloro-1,3-diphenyl | ||
|---|---|---|---|---|
| CAS Number | 16619-56-0 | Molecular Weight | 279.16100 | |
| Density | 1.257g/cm3 | Boiling Point | 413.4ºC at 760mmHg | |
| Molecular Formula | C15H12Cl2O | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 174.6ºC | |
| Name | 2,3-dichloro-1,3-diphenylpropan-1-one |
|---|---|
| Synonym | More Synonyms |
| Density | 1.257g/cm3 |
|---|---|
| Boiling Point | 413.4ºC at 760mmHg |
| Molecular Formula | C15H12Cl2O |
| Molecular Weight | 279.16100 |
| Flash Point | 174.6ºC |
| Exact Mass | 278.02700 |
| PSA | 17.07000 |
| LogP | 4.45680 |
| Vapour Pressure | 4.81E-07mmHg at 25°C |
| Index of Refraction | 1.591 |
| InChIKey | JKSKLBKKFIAHAE-UHFFFAOYSA-N |
| SMILES | O=C(c1ccccc1)C(Cl)C(Cl)c1ccccc1 |
| Precursor 0 | |
|---|---|
| DownStream 1 | |
CAS#:16619-57-1|
Name: NCI human tumor cell line growth inhibition assay. Data for the MCF7 Non-Small Cell L...
Source: DTP/NCI
Target: N/A
External Id: MCF7_OneDose
|
Total 1, Current Page 1 of 1
1
| 2,3-Dichlor-1,3-diphenyl-propan-1-on |
| Chalkondichlorid |
| 2,3-dichloro-1,3-diphenylpropanone |
| 1-Propanone,2,3-dichloro-1,3-diphenyl |
| Benzylidenacetophenon-dichlorid |